Learn More
Trifluoromethanesulfonic anhydride, 98+%, ACROS Organics™
$406.41 - $406.41
Chemical Identifiers
| CAS | 358-23-6 |
|---|---|
| Molecular Formula | C2F6O5S2 |
| Molecular Weight (g/mol) | 282.127 |
| MDL Number | MFCD00000408 |
| InChI Key | WJKHJLXJJJATHN-UHFFFAOYSA-N |
| Synonym | trifluoromethanesulfonic anhydride, triflic anhydride, trifluoromethanesulphonic anhydride, trifluoromethanesulfonic acid anhydride, methanesulfonic acid, trifluoro-, anhydride, trifluoromethanesulphonic acid anhydride, unii-8w034lhg1u, tf2o, trifluoromethane sulfonyl trifluoromethanesulfonate, trifluoromethane sulfonic anhydride |
| PubChem CID | 67749 |
| ChEBI | CHEBI:48509 |
| IUPAC Name | trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC175062500 SDS |
Acros Organics
AC175062500 |
250mL | Glass bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
| AC175060500 SDS |
Acros Organics
175060500 |
50mL | Glass bottle |
Each for $406.41
|
|
||||
Description
Alkylation reagent, Coupling reagentChemical Identifiers
| 358-23-6 | |
| 282.127 | |
| WJKHJLXJJJATHN-UHFFFAOYSA-N | |
| 67749 | |
| trifluoromethylsulfonyl trifluoromethanesulfonate |
| C2F6O5S2 | |
| MFCD00000408 | |
| trifluoromethanesulfonic anhydride, triflic anhydride, trifluoromethanesulphonic anhydride, trifluoromethanesulfonic acid anhydride, methanesulfonic acid, trifluoro-, anhydride, trifluoromethanesulphonic acid anhydride, unii-8w034lhg1u, tf2o, trifluoromethane sulfonyl trifluoromethanesulfonate, trifluoromethane sulfonic anhydride | |
| CHEBI:48509 | |
| C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F |
Specifications
| 1.7000g/mL | |
| Glass bottle | |
| 80.0°C | |
| 250mL | |
| 98+% | |
| (CF3SO2)2O | |
| 03, IV, 35 | |
| 15, 9850 | |
| WJKHJLXJJJATHN-UHFFFAOYSA-N | |
| trifluoromethylsulfonyl trifluoromethanesulfonate | |
| 67749 | |
| 282.13 | |
| ≥98% |
| Authentic | |
| 1.3200 to 1.3230 | |
| Colorless to Brown | |
| 358-23-6 | |
| C2F6O5S2 | |
| MFCD00000408 | |
| 04,533; 05,702; 06,618; 07,390; 10,419; 11,560; 12,532; 14,324; 15,339; 16,357; 17,156 | |
| trifluoromethanesulfonic anhydride, triflic anhydride, trifluoromethanesulphonic anhydride, trifluoromethanesulfonic acid anhydride, methanesulfonic acid, trifluoro-, anhydride, trifluoromethanesulphonic acid anhydride, unii-8w034lhg1u, tf2o, trifluoromethane sulfonyl trifluoromethanesulfonate, trifluoromethane sulfonic anhydride | |
| C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F | |
| 282.127 | |
| CHEBI:48509 | |
| Liquid | |
| Trifluoromethanesulfonic anhydride |
Safety and Handling
GHS H Statement:
Harmful if swallowed.
Causes severe skin burns and eye damage.
Reacts violently with water.
GHS P Statement:
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Wear eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
Immediately call a POISON CENTER or doctor/physician.
IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower.
Do not breathe dust/fume/gas/mist/vapors/spray.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
GHS Signal Word: Danger