Learn More
Trifluoromethanesulfonic anhydride, 98+%, ACROS Organics™
Trifluoromethanesulfonic anhydride, 98+%, ACROS Organics, Quantity: 250mL, Packaging: Glass bottle, Boiling Point: 80.0 deg.C, Colorless to Brown, Molecular Weight: 282.13, Percent Purity: 98+%, Assay Percent Range: 98+%, Beilstein: 03, IV, 35, CAS: 358-23-6, ChEBI: CHEBI:48509, Density: 1.7000g/mL
$429.76 - $429.76
Chemical Identifiers
| CAS | 358-23-6 |
|---|---|
| Molecular Formula | C2F6O5S2 |
| Molecular Weight (g/mol) | 282.13 |
| MDL Number | MFCD00000408 |
| InChI Key | WJKHJLXJJJATHN-UHFFFAOYSA-N |
| Synonym | methanesulfonic acid, trifluoro-, anhydride, tf2o, triflic anhydride, trifluoromethane sulfonic anhydride, trifluoromethane sulfonyl trifluoromethanesulfonate, trifluoromethanesulfonic acid anhydride, trifluoromethanesulfonic anhydride, trifluoromethanesulphonic acid anhydride, trifluoromethanesulphonic anhydride, unii-8w034lhg1u |
| PubChem CID | 67749 |
| ChEBI | CHEBI:48509 |
| IUPAC Name | trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC175060500
|
Thermo Fisher Scientific
175060500 |
50mL | Glass bottle |
Each for $429.76
|
|
AC175062500
|
Thermo Fisher Scientific
AC175062500 |
250mL | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Description
Trifluoromethanesulfonic anhydride, 98+%, ACROS Organics, Quantity: 250mL, Packaging: Glass bottle, Boiling Point: 80.0 deg.C, Colorless to Brown, Molecular Weight: 282.13, Percent Purity: 98+%, Assay Percent Range: 98+%, Beilstein: 03, IV, 35, CAS: 358-23-6, ChEBI: CHEBI:48509, Density: 1.7000g/mL
Alkylation reagent, Coupling reagentChemical Identifiers
| 358-23-6 | |
| 282.13 | |
| WJKHJLXJJJATHN-UHFFFAOYSA-N | |
| 67749 | |
| trifluoromethylsulfonyl trifluoromethanesulfonate |
| C2F6O5S2 | |
| MFCD00000408 | |
| methanesulfonic acid, trifluoro-, anhydride, tf2o, triflic anhydride, trifluoromethane sulfonic anhydride, trifluoromethane sulfonyl trifluoromethanesulfonate, trifluoromethanesulfonic acid anhydride, trifluoromethanesulfonic anhydride, trifluoromethanesulphonic acid anhydride, trifluoromethanesulphonic anhydride, unii-8w034lhg1u | |
| CHEBI:48509 | |
| C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F |
Specifications
| 1.7000g/mL | |
| Glass bottle | |
| 1.7 | |
| Colorless to Brown | |
| 358-23-6 | |
| C2F6O5S2 | |
| MFCD00000408 | |
| 04,533; 05,702; 06,618; 07,390; 10,419; 11,560; 12,532; 14,324; 15,339; 16,357; 17,156 | |
| methanesulfonic acid, trifluoro-, anhydride, tf2o, triflic anhydride, trifluoromethane sulfonic anhydride, trifluoromethane sulfonyl trifluoromethanesulfonate, trifluoromethanesulfonic acid anhydride, trifluoromethanesulfonic anhydride, trifluoromethanesulphonic acid anhydride, trifluoromethanesulphonic anhydride, unii-8w034lhg1u | |
| WJKHJLXJJJATHN-UHFFFAOYSA-N | |
| trifluoromethylsulfonyl trifluoromethanesulfonate | |
| 67749 | |
| 282.13 | |
| 98+% |
| Authentic | |
| 1.3200 to 1.3230 | |
| 80.0°C | |
| 50mL | |
| 98+% | |
| (CF3SO2)2O | |
| 03, IV, 35 | |
| 15, 9850 | |
| Solubility in water: reacts viontly with water | |
| C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F | |
| 282.13 | |
| CHEBI:48509 | |
| Liquid | |
| Trifluoromethanesulfonic anhydride |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes severe skin burns and eye damage.
Reacts violently with water.
May be corrosive to metals.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove
GHS Signal Word: Danger
EINECSNumber : 206-616-8