missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triethylene Glycol Dimethacrylate (stabilized with MEHQ) 95.0+%, TCI America™
Supplier: TCI America T094825ML
Specifications
| Triethylene Glycol Dimethacrylate (stabilized with MEHQ) | |
| Yellow | |
| C14H22O6 | |
| 25 mL | |
| HWSSEYVMGDIFMH-UHFFFAOYSA-N | |
| 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate | |
| 7979 | |
| ≥95.0% (GC) |
| 109-16-0 | |
| 155°C | |
| MFCD00008591 | |
| triethylene glycol dimethacrylate, tedma, nk ester 3g, triethylene dimethacrylate, tgm 3pc, tgm 3s, tgm 3, tgm 35, ethane-1,2-diylbis oxy bis ethane-2,1-diyl bis 2-methylacrylate, polyester tgm 3 | |
| CC(=C)C(=O)OCCOCCOCCOC(=O)C(=C)C | |
| 286.324 | |
| 286.32 | |
| Liquid |
Chemical Identifiers
| 109-16-0 | |
| 286.324 | |
| HWSSEYVMGDIFMH-UHFFFAOYSA-N | |
| 7979 | |
| CC(=C)C(=O)OCCOCCOCCOC(=O)C(=C)C |
| C14H22O6 | |
| MFCD00008591 | |
| triethylene glycol dimethacrylate, tedma, nk ester 3g, triethylene dimethacrylate, tgm 3pc, tgm 3s, tgm 3, tgm 35, ethane-1,2-diylbis oxy bis ethane-2,1-diyl bis 2-methylacrylate, polyester tgm 3 | |
| 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
Safety and Handling
EINECSNumber : (7)-1009&(7)-1438
RTECSNumber : OZ4100000
TSCA : Yes