missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Triacetin, 99%, MP Biomedicals™
Supplier: MP Biomedicals Inc 0210309890
Specifications
| Triacetin | |
| Colorless | |
| 99% | |
| 0.5 L | |
| URAYPUMNDPQOKB-UHFFFAOYSA-N | |
| 2,3-diacetyloxypropyl acetate | |
| 5541 | |
| 218.2 |
| 102-76-1 | |
| 1.159g/cm3 at 20°C | |
| C9H14O6 | |
| triacetin, glyceryl triacetate, glycerol triacetate, glycerin triacetate, enzactin, triacetine, triacetylglycerol, fungacetin, glyped, triacetyl glycerine | |
| CC(=O)OCC(COC(=O)C)OC(=O)C | |
| 218.205 | |
| CHEBI:9661 | |
| Semi-viscous Liquid |
Chemical Identifiers
| 102-76-1 | |
| 218.205 | |
| triacetin, glyceryl triacetate, glycerol triacetate, glycerin triacetate, enzactin, triacetine, triacetylglycerol, fungacetin, glyped, triacetyl glycerine | |
| CHEBI:9661 | |
| CC(=O)OCC(COC(=O)C)OC(=O)C |
| C9H14O6 | |
| URAYPUMNDPQOKB-UHFFFAOYSA-N | |
| 5541 | |
| 2,3-diacetyloxypropyl acetate |
Safety and Handling
EINECSNumber : 203-051-9
Recommended Storage : Store at room temperature.