Learn More
Tetraphenyltin, Thermo Scientific™
Manufacturer: Thermo Fisher Scientific 7111722
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Tetraphenyltin | |
| 224°C to 227°C | |
| >110°C (230°F) | |
| MFCD00003006 | |
| UN3146 | |
| 100g | |
| CRHIAMBJMSSNNM-UHFFFAOYSA-N | |
| tetraphenylstannane | |
| 61146 | |
| Crystalline |
| 595-90-4 | |
| >420°C | |
| C24H20Sn | |
| Characteristic | |
| acmc-209mem, ccris 6326, stannane, tetraphenyl, stannane,tetraphenyl, tetraphenyl tin, tetraphenyltin, tin, tetraphenyl-, | |
| Insoluble in water. | |
| C1=CC=C(C=C1)[Sn](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 427.13 | |
| 427.11 |
Chemical Identifiers
| 595-90-4 | |
| 427.13 | |
| CRHIAMBJMSSNNM-UHFFFAOYSA-N | |
| 61146 | |
| C1=CC=C(C=C1)[Sn](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| C24H20Sn | |
| MFCD00003006 | |
| acmc-209mem, ccris 6326, stannane, tetraphenyl, stannane,tetraphenyl, tetraphenyl tin, tetraphenyltin, tin, tetraphenyl-, | |
| tetraphenylstannane |
Safety and Handling
GHS H Statement
H301-H311-H331
Toxic if swallowed.
Toxic in contact with skin.
Toxic if inhaled.
P261-P264b-P270-P271-P280-P301+P310-P302+P352-P304+P340-P311-P312-P330-P361-P363-P501c
H301+H311+H331
DOTInformation : Transport Hazard Class: 6.1; Packing Group: III; Proper Shipping Name: ORGANOTIN COMPOUNDS, SOLID, N.O.S.
EINECSNumber : 209-872-9
TSCA : Yes
Recommended Storage : Ambient temperatures