missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Tetrabutylammonium fluoride, 75% solution in water, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC451800250
Specifications
| Tetrabutylammonium fluoride | |
| 0.9530g/mL | |
| 0.953 | |
| 429-41-4 | |
| [CH3(CH2)3]4NF | |
| 1-butanaminium, n,n,n-tributyl-, fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride 1:1, n,n,n-tributyl-1-butanaminium fluoride, n,n,n-tributylbutan-1-aminium fluoride, tbaf, tetra-n-butylammonium fluoride, tetrabutyl ammonium fluoride, tetrabutylamine, fluoride, tetrabutylammonium fluoride, tetrabutylazanium fluoride | |
| CCCC[N+](CCCC)(CCCC)CCCC.[F-] | |
| 261.46 | |
| CHEBI:51990 | |
| Liquid |
| 75% in aqueous solution | |
| Glass bottle | |
| 25g | |
| C16H36FN | |
| 15,9332 | |
| FPGGTKZVZWFYPV-UHFFFAOYSA-M | |
| tetrabutylazanium;fluoride | |
| 2724141 | |
| 261.46 |
Chemical Identifiers
| 429-41-4 | |
| 261.46 | |
| 1-butanaminium, n,n,n-tributyl-, fluoride, 1-butanaminium, n,n,n-tributyl-, fluoride 1:1, n,n,n-tributyl-1-butanaminium fluoride, n,n,n-tributylbutan-1-aminium fluoride, tbaf, tetra-n-butylammonium fluoride, tetrabutyl ammonium fluoride, tetrabutylamine, fluoride, tetrabutylammonium fluoride, tetrabutylazanium fluoride | |
| CHEBI:51990 | |
| CCCC[N+](CCCC)(CCCC)CCCC.[F-] |
| C16H36FN | |
| FPGGTKZVZWFYPV-UHFFFAOYSA-M | |
| 2724141 | |
| tetrabutylazanium;fluoride |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Causes severe skin burns and eye damage.
GHS Signal Word: Danger
EINECSNumber : 207-057-2