Learn More
tert-Butyl peroxybenzoate, 98%, Thermo Scientific™
$78.65 - $202.75
Chemical Identifiers
| CAS | 614-45-9 |
|---|---|
| Molecular Formula | C11H14O3 |
| Molecular Weight (g/mol) | 194.23 |
| MDL Number | MFCD00008802 |
| InChI Key | GJBRNHKUVLOCEB-UHFFFAOYSA-N |
| Synonym | chaloxyd tbpb, esperox 10, novox, perbutyl z, t-butyl perbenzoate, terc.butylperbenzoan, tert-butyl perbenzoate, tert-butyl peroxy benzoate, tert-butyl peroxybenzoate, trigonox c |
| PubChem CID | 11966 |
| IUPAC Name | tert-butyl benzenecarboperoxoate |
| SMILES | CC(C)(C)OOC(=O)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC170142500
|
Thermo Fisher Scientific
170142500 |
250g | Plastic bottle |
Each for $78.65
|
|
AC170140010
|
Thermo Fisher Scientific
170140010 |
1kg | Plastic bottle |
Each for $202.75
|
|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Radical initiatorsChemical Identifiers
| 614-45-9 | |
| 194.23 | |
| GJBRNHKUVLOCEB-UHFFFAOYSA-N | |
| 11966 | |
| CC(C)(C)OOC(=O)C1=CC=CC=C1 |
| C11H14O3 | |
| MFCD00008802 | |
| chaloxyd tbpb, esperox 10, novox, perbutyl z, t-butyl perbenzoate, terc.butylperbenzoan, tert-butyl perbenzoate, tert-butyl peroxy benzoate, tert-butyl peroxybenzoate, trigonox c | |
| tert-butyl benzenecarboperoxoate |
Specifications
| 614-45-9 | |
| Yellow | |
| 75.0°C to 76.0°C (0.2mmHg) | |
| 97.5% min. (GC) | |
| Authentic | |
| MFCD00008802 | |
| 09, IV, 715 | |
| 1.4980 to 1.5000 | |
| chaloxyd tbpb, esperox 10, novox, perbutyl z, t-butyl perbenzoate, terc.butylperbenzoan, tert-butyl perbenzoate, tert-butyl peroxy benzoate, tert-butyl peroxybenzoate, trigonox c | |
| 1.04 | |
| CC(C)(C)OOC(=O)C1=CC=CC=C1 | |
| 194.23 | |
| 194.23 | |
| 98% | |
| tert-Butyl peroxybenzoate, 98% |
| 1.0400g/mL | |
| 8.0°C | |
| 93°C | |
| C11H14O3 | |
| C6H5CO2OC(CH3)3 | |
| Plastic bottle | |
| 01,98; 02,54; 04,66; 07,49; 09,90; 13,58 | |
| 250g | |
| Solubility in water: immiscible. Other solubilities: soluble in alcohols,esters,ethers and ketones | |
| GJBRNHKUVLOCEB-UHFFFAOYSA-N | |
| tert-butyl benzenecarboperoxoate | |
| 11966 | |
| Liquid | |
| 6 mPa.s (20°C) |
Safety and Handling
GHS H Statement
Causes skin irritation.
Harmful if inhaled.
Heating may cause a fire.
May cause an allergic skin reaction.
Very toxic to aquatic life.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
Keep/Store away from cl
GHS Signal Word: Danger
EINECSNumber : 210-382-2
RTECSNumber : SD9450000
TSCA : TSCA
RUO – Research Use Only