missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Sulfur ICP Standard, 10,000 ppm S in H2O, Ricca Chemical
Supplier: Ricca Chemical Company PS10KW100
Specifications
| Sulfur ICP Standard | |
| Natural LDPE Bottle | |
| 94.0,3.88 | |
| Colorless | |
| H8N2O4S | |
| [NH4+].[NH4+].[O-]S(=O)(=O)[O-] | |
| 132.134 | |
| CHEBI:62946 |
| 7783-20-2,7732-18-5 | |
| 100 mL | |
| 98.0,4.04 | |
| 10,000ppm S | |
| BFNBIHQBYMNNAN-UHFFFAOYSA-N | |
| diazanium;sulfate | |
| 6097028 | |
| 1 mL = 10 mg S |
Chemical Identifiers
| 7783-20-2 | |
| 132.134 | |
| 6097028 | |
| diazanium;sulfate |
| H8N2O4S | |
| BFNBIHQBYMNNAN-UHFFFAOYSA-N | |
| CHEBI:62946 | |
| [NH4+].[NH4+].[O-]S(=O)(=O)[O-] |