missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Sodium benzoate, 99%, for biochemistry, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC447802500
Specifications
| Sodium benzoate | |
| Plastic bottle | |
| >300.0°C | |
| 532-32-1 | |
| C7H5NaO2 | |
| 15,8718 | |
| (1 M in water) Clear colorless to light yellow | |
| C1=CC=C(C=C1)C(=O)[O-].[Na+] | |
| 144.11 | |
| 144.11 | |
| Biochemistry |
| 0.05% max | |
| 0.05% max | |
| 250g | |
| 99% | |
| C6H5CO2Na | |
| antimol, benzoate of soda, benzoate sodium, benzoate, sodium, benzoic acid sodium salt, benzoic acid, sodium salt, caswell no. 746, natrium benzoicum, sobenate, sodium benzoate | |
| WXMKPNITSTVMEF-UHFFFAOYSA-M | |
| sodium;benzoate | |
| 517055 | |
| 99% |
Chemical Identifiers
| 532-32-1 | |
| 144.11 | |
| antimol, benzoate of soda, benzoate sodium, benzoate, sodium, benzoic acid sodium salt, benzoic acid, sodium salt, caswell no. 746, natrium benzoicum, sobenate, sodium benzoate | |
| sodium;benzoate |
| C7H5NaO2 | |
| WXMKPNITSTVMEF-UHFFFAOYSA-M | |
| 517055 | |
| C1=CC=C(C=C1)C(=O)[O-].[Na+] |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
GHS Signal Word: Warning
EINECSNumber : 208-534-8