missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
(S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Acid 98.0+%, TCI America™
Supplier: TCI America M08325G
Specifications
| (S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Acid [Optical Resolving] | |
| White | |
| MFCD00064200 | |
| s---alpha-methoxy-alpha-trifluoromethyl phenylacetic acid, s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid, --mosher's acid, --mtpa, unii-172hcj1iqv, 172hcj1iqv, 2s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid, --alpha-methoxy-alpha-trifluoromethyl phenylacetic acid, s---mtpa, --a-methoxy-a-trifluoromethylphenylacetic acid | |
| CO[C@](C([O-])=O)(C1=CC=CC=C1)C(F)(F)F | |
| 233.17 | |
| 234.17 | |
| Crystalline Lumps |
| 17257-71-5 | |
| C10H8F3O3 | |
| 5 g | |
| JJYKJUXBWFATTE-VIFPVBQESA-M | |
| (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate | |
| 6992788 | |
| ≥98.0% (GC,T) |
Chemical Identifiers
| 17257-71-5 | |
| 233.17 | |
| JJYKJUXBWFATTE-VIFPVBQESA-M | |
| 6992788 | |
| CO[C@](C([O-])=O)(C1=CC=CC=C1)C(F)(F)F |
| C10H8F3O3 | |
| MFCD00064200 | |
| s---alpha-methoxy-alpha-trifluoromethyl phenylacetic acid, s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid, --mosher's acid, --mtpa, unii-172hcj1iqv, 172hcj1iqv, 2s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid, --alpha-methoxy-alpha-trifluoromethyl phenylacetic acid, s---mtpa, --a-methoxy-a-trifluoromethylphenylacetic acid | |
| (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
Safety and Handling
TSCA : Yes