missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
(S)-1-BOC-3-(Aminomethyl)piperidine, 97%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC437470010
Specifications
| (S)-1-BOC-3-(Aminomethyl)piperidine | |
| Glass bottle | |
| Colorless | |
| 140645-24-5 | |
| 100.0 | |
| C11H22N2O2 | |
| WPWXYQIMXTUMJB-VIFPVBQESA-N | |
| tert-butyl (3S)-3-(aminomethyl)piperidine-1-carboxylate | |
| 1502022 | |
| Liquid |
| Authentic | |
| -15 | |
| 1g | |
| 96.0 | |
| 96% min. (GC) | |
| 3s-3-aminomethyl-n-tert-butoxycarbonylpiperidine | |
| CC(C)(C)OC(=O)N1CCCC(C1)CN | |
| 214.31 | |
| 214.31 | |
| 97% |
Chemical Identifiers
| 140645-24-5 | |
| 214.31 | |
| 3s-3-aminomethyl-n-tert-butoxycarbonylpiperidine | |
| tert-butyl (3S)-3-(aminomethyl)piperidine-1-carboxylate |
| C11H22N2O2 | |
| WPWXYQIMXTUMJB-VIFPVBQESA-N | |
| 1502022 | |
| CC(C)(C)OC(=O)N1CCCC(C1)CN |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
IF
GHS Signal Word: Warning