missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Rivastigmine L-Tartrate, TCI America™
Manufacturer: TCI America R00935G
Specifications
| Rivastigmine L-Tartrate | |
| 126°C | |
| 129101-54-8 | |
| 2811 | |
| GWHQHAUAXRMMOT-MBANBULQSA-N | |
| (2R,3R)-2,3-dihydroxybutanedioic acid;[3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate | |
| 6918078 | |
| 400.43 | |
| ≥98.0% (HPLC,T) |
| White | |
| 5g | |
| C18H28N2O8 | |
| rivastigmine tartrate, rivastigmine bitartrate, sdz-ena 713, rivastigmine tartrate, rivastigmine hydrogen tartrate, rivastigmine hydrogentartrate, unii-9iy2357jpe, s-3-1-dimethylamino ethyl phenyl ethyl methyl carbamate 2r,3r-2,3-dihydroxysuccinate, rivastigmine tartrate exelon, carbamic acid, ethylmethyl-, 3-1s-1-dimethylamino ethyl phenyl ester, 2r,3r-2,3-dihydroxybutanedioate 1:1 | |
| CCN(C)C(=O)OC1=CC=CC(=C1)C(C)N(C)C.C(C(C(=O)O)O)(C(=O)O)O | |
| 400.428 | |
| CHEBI:64358 | |
| Crystal-Powder at 20°C |
Chemical Identifiers
| 129101-54-8 | |
| 400.428 | |
| rivastigmine tartrate, rivastigmine bitartrate, sdz-ena 713, rivastigmine tartrate, rivastigmine hydrogen tartrate, rivastigmine hydrogentartrate, unii-9iy2357jpe, s-3-1-dimethylamino ethyl phenyl ethyl methyl carbamate 2r,3r-2,3-dihydroxysuccinate, rivastigmine tartrate exelon, carbamic acid, ethylmethyl-, 3-1s-1-dimethylamino ethyl phenyl ester, 2r,3r-2,3-dihydroxybutanedioate 1:1 | |
| CHEBI:64358 | |
| CCN(C)C(=O)OC1=CC=CC(=C1)C(C)N(C)C.C(C(C(=O)O)O)(C(=O)O)O |
| C18H28N2O8 | |
| GWHQHAUAXRMMOT-MBANBULQSA-N | |
| 6918078 | |
| (2R,3R)-2,3-dihydroxybutanedioic acid;[3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate |
Safety and Handling
RTECSNumber : FA9550000
TSCA : No