missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Resazurin Sodium Salt 85.0+%, TCI America™
Supplier: TCI America R02035G
Specifications
| Resazurin Sodium Salt | |
| Black-Green | |
| MFCD00005036 | |
| resazurin sodium salt, resazurin, sodium salt, 7-hydroxy-3h-phenoxazin-3-one-10-oxide sodium salt, sodium 3-oxo-3h-phenoxazin-7-olate 10-oxide, sodium 7-oxophenoxazin-10-ium-3,10-bis olate, sodium 10-oxido-7-oxophenoxazin-10-ium-3-olate, sodium; 7-oxo-10-oxy-7h-phenoxazin-3-olate, sodium 10-oxo-10h-10??-phenoxazin-10-ylium-3,7-bis olate, resazurin sodium salt 1g | |
| C1=CC2=C(C=C1[O-])OC3=CC(=O)C=CC3=[N+]2[O-].[Na+] | |
| 251.173 | |
| 251.17 | |
| Crystalline Powder |
| 62758-13-8 | |
| C12H6NNaO4 | |
| 5 g | |
| IVGPGQSSDLDOLH-UHFFFAOYSA-M | |
| sodium;10-oxido-7-oxophenoxazin-10-ium-3-olate | |
| 112939 | |
| ≥85.0% (HPLC) |
Chemical Identifiers
| 62758-13-8 | |
| 251.173 | |
| IVGPGQSSDLDOLH-UHFFFAOYSA-M | |
| 112939 | |
| C1=CC2=C(C=C1[O-])OC3=CC(=O)C=CC3=[N+]2[O-].[Na+] |
| C12H6NNaO4 | |
| MFCD00005036 | |
| resazurin sodium salt, resazurin, sodium salt, 7-hydroxy-3h-phenoxazin-3-one-10-oxide sodium salt, sodium 3-oxo-3h-phenoxazin-7-olate 10-oxide, sodium 7-oxophenoxazin-10-ium-3,10-bis olate, sodium 10-oxido-7-oxophenoxazin-10-ium-3-olate, sodium; 7-oxo-10-oxy-7h-phenoxazin-3-olate, sodium 10-oxo-10h-10??-phenoxazin-10-ylium-3,7-bis olate, resazurin sodium salt 1g | |
| sodium;10-oxido-7-oxophenoxazin-10-ium-3-olate |
Safety and Handling
TSCA : Yes