missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
(R)-N-BOC-α-Ethylalanine, 98%, 98% ee, ACROS Organics™
Manufacturer: Acros Organics AC441061000
Specifications
| (R)-N-BOC-α-Ethylalanine | |
| Authentic | |
| White to Yellow | |
| 98% ee | |
| 97.5 | |
| 98% | |
| boc-d-isovaline, r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid, r-2-tert-butoxycarbonylamino-2-methylbutanoic acid, boc-iso-valine, r-n-boc-a-ethylalanine, s-n-boc-a-ethylalanine, r-2-methyl-2-tert-butoxycarbonylamino butyric acid, 2r-2-tert-butoxycarbonylamino-2-methyl-butanoic acid, 2r-2-tert-butoxy carbonyl amino-2-methylbutanoic acid, 2r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid | |
| CCC(C)(C(=O)O)NC(=O)OC(C)(C)C | |
| 217.265 | |
| 217.27 | |
| ≥97.5% |
| 98% min. (HPLC) | |
| -8° to -14° (20°C, 589nm) (c=1 in CHCl3) | |
| 100mg | |
| 123254-58-0 | |
| 100.0 | |
| C10H19NO4 | |
| SHZXLTCEPXVCSV-SNVBAGLBSA-N | |
| (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid | |
| 14284791 | |
| Powder |
Chemical Identifiers
| 123254-58-0 | |
| 217.265 | |
| boc-d-isovaline, r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid, r-2-tert-butoxycarbonylamino-2-methylbutanoic acid, boc-iso-valine, r-n-boc-a-ethylalanine, s-n-boc-a-ethylalanine, r-2-methyl-2-tert-butoxycarbonylamino butyric acid, 2r-2-tert-butoxycarbonylamino-2-methyl-butanoic acid, 2r-2-tert-butoxy carbonyl amino-2-methylbutanoic acid, 2r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid | |
| (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| C10H19NO4 | |
| SHZXLTCEPXVCSV-SNVBAGLBSA-N | |
| 14284791 | |
| CCC(C)(C(=O)O)NC(=O)OC(C)(C)C |