Learn More
(R)-(+)-Bis-(1,2-diphenylphosphino)propane, 93%, Tech., ACROS Organics™
Manufacturer: Thermo Fisher Scientific 254900010
Specifications
| (R)-(+)-Bis-(1, 2-diphenylphosphino)propane | |
| Glass bottle | |
| White | |
| 1g | |
| 67884-32-6 | |
| 100.0 | |
| C27H26P2 | |
| MFCD00012309 | |
| r-+-1,2-bis diphenylphosphino propane, r-+-1,2bis diphenylphosphino propane, r-+-bis 1,2-diphenylphosphino propane, r-+-bis-1,2-diphenylphosphino propane, r-+-prophos, r-+-propylenebis 1,2-diphenylphosphine, r-propane-1,2-diylbis diphenylphosphine, r-prophos | |
| CC(CP(C1=CC=CC=C1)C2=CC=CC=C2)P(C3=CC=CC=C3)C4=CC=CC=C4 | |
| 412.45 | |
| 412.45 | |
| 93% |
| Authentic | |
| + 172.50 | |
| 68.0°C to 73.0°C | |
| tech., 93% | |
| 91.0 | |
| 91% min. (GC) | |
| (C6H5)2PCH(CH3)CH2P(C6H5)2 | |
| 17,259; 05,15 | |
| WGOBPPNNYVSJTE-HSZRJFAPSA-N | |
| [(2R)-1-diphenylphosphanylpropan-2-yl]-diphenylphosphane | |
| 2724539 | |
| Granular Powder | |
| Technical |
Chemical Identifiers
| 67884-32-6 | |
| 412.45 | |
| WGOBPPNNYVSJTE-HSZRJFAPSA-N | |
| 2724539 | |
| CC(CP(C1=CC=CC=C1)C2=CC=CC=C2)P(C3=CC=CC=C3)C4=CC=CC=C4 |
| C27H26P2 | |
| MFCD00012309 | |
| r-+-1,2-bis diphenylphosphino propane, r-+-1,2bis diphenylphosphino propane, r-+-bis 1,2-diphenylphosphino propane, r-+-bis-1,2-diphenylphosphino propane, r-+-prophos, r-+-propylenebis 1,2-diphenylphosphine, r-propane-1,2-diylbis diphenylphosphine, r-prophos | |
| [(2R)-1-diphenylphosphanylpropan-2-yl]-diphenylphosphane |
Safety and Handling
GHS H Statement:
Causes serious eye irritation.
Very toxic to aquatic life with long lasting effects.
Causes skin irritation.
May cause respiratory irritation.
GHS P Statement:
Avoid breathing dust/fume/gas/mist/vapors/spray.
Avoid release to the environment.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
GHS Signal Word: Warning
TSCA : TSCA