missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
(R)-(+)-3-Aminotetrahydrofuran p-toluenesulfonate salt, 95%, Acros Organics
Manufacturer: Thermo Fisher Scientific AC435820050
Specifications
| (R)-(+)-3-Aminotetrahydrofuran p-toluenesulfonate salt | |
| Authentic | |
| 4.3 | |
| 137.3°C to 141°C | |
| 111769-27-8 | |
| 100.0 | |
| C7H8O3S·C4H9NO | |
| BZXPLADBSZWDIH-FZSMXKCYSA-N | |
| 4-methylbenzenesulfonic acid;(3R)-oxolan-3-amine | |
| 14243169 | |
| Crystalline Powder |
| 48.91 to 52.99% C, 5.18 to 5.62% N | |
| Glass bottle | |
| White | |
| 5g | |
| 96.0 | |
| 95% | |
| 3-furanamine, tetrahydro-, r-, 4-methylbenzenesulfonate | |
| CC1=CC=C(C=C1)S(=O)(=O)O.C1COCC1N | |
| 259.32 | |
| 259.32 | |
| 95% |
Chemical Identifiers
| 111769-27-8 | |
| 259.32 | |
| 3-furanamine, tetrahydro-, r-, 4-methylbenzenesulfonate | |
| 4-methylbenzenesulfonic acid;(3R)-oxolan-3-amine |
| C7H8O3S·C4H9NO | |
| BZXPLADBSZWDIH-FZSMXKCYSA-N | |
| 14243169 | |
| CC1=CC=C(C=C1)S(=O)(=O)O.C1COCC1N |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
IF
GHS Signal Word: Warning