missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
(R)-1-BOC-3-hydroxypiperidine, 97%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC436430050
Specifications
| (R)-1-BOC-3-Hydroxypiperidine | |
| Authentic | |
| -8.5° to -12.0° (20°C, 589nm) (c=1 in CHCl3) | |
| 40.0°C to 42.0°C | |
| 143900-43-0 | |
| 100.0 | |
| C10H19NO3 | |
| UIJXHKXIOCDSEB-MRVPVSSYSA-N | |
| tert-butyl (3R)-3-hydroxypiperidine-1-carboxylate | |
| 1514398 | |
| Low Melting Solid |
| 104.4°C | |
| Glass bottle | |
| Tan to White | |
| 5g | |
| 96.0 | |
| 96% min. (GC) | |
| 1-piperidinecarboxylic acid, 3-hydroxy-, 1,1-dimethylethyl ester, 3r | |
| CC(C)(C)OC(=O)N1CCCC(C1)O | |
| 201.26 | |
| 201.26 | |
| 97% |
Chemical Identifiers
| 143900-43-0 | |
| 201.26 | |
| 1-piperidinecarboxylic acid, 3-hydroxy-, 1,1-dimethylethyl ester, 3r | |
| tert-butyl (3R)-3-hydroxypiperidine-1-carboxylate |
| C10H19NO3 | |
| UIJXHKXIOCDSEB-MRVPVSSYSA-N | |
| 1514398 | |
| CC(C)(C)OC(=O)N1CCCC(C1)O |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Immediately call a POISON CENTER or doctor/physician.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fresh air and kee
GHS Signal Word: Danger