missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Quinidine, 98%, anhydrous, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC163681000
Specifications
| Quinidine | |
| Glass bottle | |
| White | |
| 100g | |
| 98% | |
| MFCD00135581 | |
| +-quinidine, 8r,9s-quinidine, chinidin, cin-quin, conchinin, conchinine, conquinine, pitayine, quinidex, quinidine | |
| LOUPRKONTZGTKE-LHHVKLHASA-N | |
| (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol | |
| 441074 | |
| 324.42 | |
| 98% |
| Authentic | |
| + 256.00 | |
| 170.0°C to 175.0°C | |
| 56-54-2 | |
| C20H24N2O2 | |
| 15, 8176 | |
| Solubility in water: 1g/2000mL (20°C)- 1g/800mL (100°C). Other solubilities: 1g/36mL alcohol- soluble in methanol,1g/56mL ether- 1g/1.6mL chloroform,practically insoluble in petroleum ether | |
| COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O | |
| 324.42 | |
| CHEBI:28593 | |
| Powder |
Chemical Identifiers
| 56-54-2 | |
| 324.42 | |
| LOUPRKONTZGTKE-LHHVKLHASA-N | |
| 441074 | |
| (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| C20H24N2O2 | |
| MFCD00135581 | |
| +-quinidine, 8r,9s-quinidine, chinidin, cin-quin, conchinin, conchinine, conquinine, pitayine, quinidex, quinidine | |
| CHEBI:28593 | |
| COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O |
Safety and Handling
GHS H Statement
Toxic if swallowed.
May cause an allergic skin reaction.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing.
IF ON SKIN: Wash with plenty of soap and water.
If skin irritation or rash occurs: Get medical advice/at
GHS Signal Word: Danger
EINECSNumber : 200-279-