missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Potassium Hydrogen Phthalate (Primary Standard/Meets ACS Specifications), Fisher Chemical™
Note: This reagent is satisfactory for use as a pH standard. For use as an acidimetric standard, this material should be lightly crushed and dried for 2 hours at 120°C to remove any absorbed moisture
Supplier: Thermo Fisher Scientific P243500
Specifications
| Potassium Hydrogen Phthalate | |
| 295°C | |
| 3.8 to 4.0 | |
| ≥98.5 % | |
| C8H5KO4 | |
| MFCD00013070 | |
| potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 23676735 | |
| 99.95 to 100.05% | |
| Solid |
| 877-24-7 | |
| White | |
| Also meets ACS specifications | |
| Glass Bottle | |
| 1-(HO2C)-2-(CO2K)-C6H4 | |
| 500 g | |
| 0.005% max. Insoluble Matter | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.222 | |
| 204.23 | |
| Primary Standard |
Chemical Identifiers
| 877-24-7 | |
| 204.222 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| C8H5KO4 | |
| MFCD00013070 | |
| potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic | |
| potassium;2-carboxybenzoate |
Safety and Handling