missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Potassium hydrogen phthalate, ACS reagent, acidimetric standard, ACROS Organics™
$39.42 - $471.54
Chemical Identifiers
| CAS | 877-24-7 |
|---|---|
| Molecular Formula | C8H5KO4 |
| Molecular Weight (g/mol) | 204.22 |
| MDL Number | MFCD00013070 |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Synonym | 1,2-benzenedicarboxylic acid, monopotassium salt |
| PubChem CID | 23676735 |
| IUPAC Name | potassium;2-carboxybenzoate |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC424061000 SDS |
Thermo Fisher Scientific
424061000 |
100g | Plastic bottle |
Each for $39.42
|
|
AC424065000 SDS |
Fisher Scientific Acros
424065000 |
500g | Plastic bottle |
Each for $131.58
|
|
AC424060025 SDS |
Thermo Fisher Scientific
AC424060025 |
2.5kg | Plastic bottle |
Each for $471.54
|
|
Chemical Identifiers
| 877-24-7 | |
| 204.22 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| C8H5KO4 | |
| MFCD00013070 | |
| 1,2-benzenedicarboxylic acid, monopotassium salt | |
| potassium;2-carboxybenzoate |
Specifications
| Authentic | |
| Plastic bottle | |
| 295.0°C to 300.0°C | |
| 4.00 to 4.02 (0.05M soln. at 25°C ±0.2°C) | |
| C8H5KO4 | |
| MFCD00013070 | |
| 15, 7733 | |
| Solubility in water: 80g/L (20°C). Other solubilities: 330g/L water (100°C),slightly soluble in alcohol | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.22 | |
| 204.22 | |
| 99.95 to 100.05% (on dried substance) | |
| Potassium hydrogen phthalate |
| 0.005% max | |
| White | |
| 100g | |
| 877-24-7 | |
| 2-(HO2C)C6H4CO2K | |
| 09, 791 | |
| 1,2-benzenedicarboxylic acid, monopotassium salt | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 23676735 | |
| Crystals or Crystalline Powder | |
| ACS Reagent |
Safety and Handling
EINECSNumber : 212-889-4
RTECSNumber : CZ4326000
TSCA : TSCA