missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Potassium hydrogen phthalate, ACS reagent, acidimetric standard, ACROS Organics™
$43.31 - $511.22
Chemical Identifiers
| CAS | 877-24-7 |
|---|---|
| Molecular Formula | C8H5KO4 |
| Molecular Weight (g/mol) | 204.22 |
| MDL Number | MFCD00013070 |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Synonym | 1,2-benzenedicarboxylic acid, monopotassium salt, hydrogen potassium phthalate, monopotassium phthalate, phthalic acid monopotassium salt, phthalic acid potassium salt, phthalic acid, monopotassium salt, potassium acid phthalate, potassium biphthalate, potassium hydrogen phthalate, potassium phthalate monobasic |
| PubChem CID | 23676735 |
| IUPAC Name | potassium;2-carboxybenzoate |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC424061000
|
Thermo Fisher Scientific
424061000 |
100g | Plastic bottle |
Each for $43.31
|
|
AC424065000
|
Fisher Scientific Acros
424065000 |
500g | Plastic bottle |
Each for $143.11
|
|
AC424060025
|
Thermo Fisher Scientific
AC424060025 |
2.5kg | Plastic bottle |
Each for $511.22
|
|
Chemical Identifiers
| 877-24-7 | |
| 204.22 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| C8H5KO4 | |
| MFCD00013070 | |
| 1,2-benzenedicarboxylic acid, monopotassium salt, hydrogen potassium phthalate, monopotassium phthalate, phthalic acid monopotassium salt, phthalic acid potassium salt, phthalic acid, monopotassium salt, potassium acid phthalate, potassium biphthalate, potassium hydrogen phthalate, potassium phthalate monobasic | |
| potassium;2-carboxybenzoate |
Specifications
| Authentic | |
| Plastic bottle | |
| 295.0°C to 300.0°C | |
| 4.00 to 4.02 (0.05M soln. at 25°C ±0.2°C) | |
| C8H5KO4 | |
| MFCD00013070 | |
| 15, 7733 | |
| Solubility in water: 80g/L (20°C). Other solubilities: 330g/L water (100°C),slightly soluble in alcohol | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.22 | |
| 204.22 | |
| 99.95 to 100.05% (on dried substance) | |
| Potassium hydrogen phthalate |
| 0.005% max | |
| White | |
| 100g | |
| 877-24-7 | |
| 2-(HO2C)C6H4CO2K | |
| 09, 791 | |
| 1,2-benzenedicarboxylic acid, monopotassium salt, hydrogen potassium phthalate, monopotassium phthalate, phthalic acid monopotassium salt, phthalic acid potassium salt, phthalic acid, monopotassium salt, potassium acid phthalate, potassium biphthalate, potassium hydrogen phthalate, potassium phthalate monobasic | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 23676735 | |
| Crystals or Crystalline Powder | |
| ACS Reagent |
Safety and Handling
EINECSNumber : 212-889-4
RTECSNumber : CZ4326000
TSCA : TSCA