missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Phenethyl Caffeate 98.0+%, TCI America™
Supplier: TCI America P2088250MG
Specifications
| Phenethyl Caffeate | |
| 129°C | |
| C17H16O4 | |
| 250 mg | |
| SWUARLUWKZWEBQ-VQHVLOKHSA-N | |
| 2-phenylethyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate | |
| 5281787 | |
| 284.31 | |
| Crystalline Powder |
| 104594-70-9 | |
| White-Yellow | |
| MFCD00866470 | |
| caffeic acid phenethyl ester, phenethyl caffeate, cape, capeee, phenethyl 3-3,4-dihydroxyphenyl acrylate, phenylethyl caffeate, unii-g960r9s5sk, caffeic acid phenylethyl ester, 2-phenylethyl caffeate, caffeic acid 2-phenylethyl ester | |
| OC1=CC=C(\C=C\C(=O)OCCC2=CC=CC=C2)C=C1O | |
| 284.31 | |
| CHEBI:8062 | |
| ≥98.0% (HPLC) |
Chemical Identifiers
| 104594-70-9 | |
| 284.31 | |
| SWUARLUWKZWEBQ-VQHVLOKHSA-N | |
| 5281787 | |
| 2-phenylethyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| C17H16O4 | |
| MFCD00866470 | |
| caffeic acid phenethyl ester, phenethyl caffeate, cape, capeee, phenethyl 3-3,4-dihydroxyphenyl acrylate, phenylethyl caffeate, unii-g960r9s5sk, caffeic acid phenylethyl ester, 2-phenylethyl caffeate, caffeic acid 2-phenylethyl ester | |
| CHEBI:8062 | |
| OC1=CC=C(\C=C\C(=O)OCCC2=CC=CC=C2)C=C1O |
Safety and Handling
RTECSNumber : UD3334375
TSCA : No
Recommended Storage : Freezer