Learn More
Perfluorobutyl iodide, 99%, ACROS Organics™
Manufacturer: Acros Organics AC269951000
Specifications
| Perfluorobutyl iodide | |
| Authentic | |
| 1.3275 to 1.3295 (20°C, 589nm) | |
| 100g | |
| 99% | |
| CF3(CF2)3I | |
| perfluorobutyl iodide, nonafluoro-1-iodobutane, nonafluorobutyl iodide, perfluorobutyliodide, n-nonafluorobutyl iodide, perfluoro-n-butyl iodide, 1-iodoperfluorobutane, ccris 9008, 1-iodononafluorobutane, butane, 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodo | |
| C(C(C(F)(F)I)(F)F)(C(F)(F)F)(F)F | |
| 345.934 | |
| 345.92 | |
| ≥98.5% |
| 2.01g/mL | |
| Glass bottle | |
| Purple | |
| 423-39-2 | |
| C4F9I | |
| MFCD00001062 | |
| PGRFXXCKHGIFSV-UHFFFAOYSA-N | |
| 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodobutane | |
| 67917 | |
| Liquid |
Chemical Identifiers
| 423-39-2 | |
| 345.934 | |
| PGRFXXCKHGIFSV-UHFFFAOYSA-N | |
| 67917 | |
| C(C(C(F)(F)I)(F)F)(C(F)(F)F)(F)F |
| C4F9I | |
| MFCD00001062 | |
| perfluorobutyl iodide, nonafluoro-1-iodobutane, nonafluorobutyl iodide, perfluorobutyliodide, n-nonafluorobutyl iodide, perfluoro-n-butyl iodide, 1-iodoperfluorobutane, ccris 9008, 1-iodononafluorobutane, butane, 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodo | |
| 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodobutane |
Safety and Handling
GHS H Statement:
Causes serious eye irritation.
Causes skin irritation.
May cause respiratory irritation.
GHS P Statement:
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.