Learn More
Alfa Aesar™ p-Toluenesulfonic acid monohydrate, ACS, 98.5+%
Manufacturer: Alfa Aesar™ 4400236
Specifications
| p-Toluenesulfonic acid monohydrate | |
| C7H10O4S | |
| UN2585 | |
| 14,9533 | |
| 1.24g/mL | |
| CC1=CC=C(C=C1)S(=O)(=O)O.O | |
| 190.213 | |
| 190.22 (172.20 Anhydrous) | |
| ≥98.5% | |
| Mild | |
| Pink to White | |
| 500g | |
| Hygroscopic |
| 6192-52-5 | |
| MFCD00142137 | |
| 3568023 | |
| p-toluenesulfonic acid monohydrate, 4-methylbenzenesulfonic acid hydrate, 4-methylbenzenesulfonic acid monohydrate, p-toluene sulfonic acid monohydrate, unii-3bto78gaff, benzenesulfonic acid, 4-methyl-, monohydrate, ptoluenesulfonic acid, p-toluenesulfonic acid, monohydrate, 3bto78gaff, 4-methylbenzene-1-sulfonic acid hydrate | |
| KJIFKLIQANRMOU-UHFFFAOYSA-N | |
| 4-methylbenzenesulfonic acid;hydrate | |
| 521998 | |
| Crystalline | |
| ACS | |
| 103°C to 106°C (anhydrous) | |
| 140°C (20mmHg) | |
| 150°C (302°F) |
Chemical Identifiers
| 6192-52-5 | |
| 190.213 | |
| KJIFKLIQANRMOU-UHFFFAOYSA-N | |
| 521998 | |
| CC1=CC=C(C=C1)S(=O)(=O)O.O |
| C7H10O4S | |
| MFCD00142137 | |
| p-toluenesulfonic acid monohydrate, 4-methylbenzenesulfonic acid hydrate, 4-methylbenzenesulfonic acid monohydrate, p-toluene sulfonic acid monohydrate, unii-3bto78gaff, benzenesulfonic acid, 4-methyl-, monohydrate, ptoluenesulfonic acid, p-toluenesulfonic acid, monohydrate, 3bto78gaff, 4-methylbenzene-1-sulfonic acid hydrate | |
| 4-methylbenzenesulfonic acid;hydrate |
Safety and Handling
GHS H Statement
H314-H335-H319
Causes severe skin burns and eye damage.
May cause respiratory irritation.
Causes serious eye irritation.
GHS P Statement
P260-P303+P361+P353-P305+P351+P338-P301+P330+P331-P405-P501a
Do not breathe dust/fume/gas/mist/vapors/spray.
IF ON SKIN (or hair): Remove/Take off immediately all contaminated clothing. Rinse skin with water/shower.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do.
Continue rinsing.
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
Store locked up.
Dispose of contents/container in accordance with local/regional/national/international regulations.
Danger
DOTInformation : Transport Hazard Class: 8; Packing Group: III; Proper Shipping Name: ARYL SULFONIC ACIDS, SOLID
RTECSNumber : DB7164000
TSCA : TSCA