missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Specifications
| p-Quaterphenyl | |
| 25g | |
| C24H18 | |
| p-quaterphenyl, 1,1':4',1:4,1'-quaterphenyl, benzerythrene, quadriphenyl, p-tetraphenyl, 4,4'-diphenylbiphenyl, p,p'-quaterphenyl, 4-quaterphenyl, unii-g8aqm6d0rk, 1-phenyl-4-4-phenylphenyl benzene | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C4=CC=CC=C4 | |
| 306.408 | |
| CHEBI:52240 | |
| Crystal-Powder at 20°C |
| White | |
| 135-70-6 | |
| MFCD00003062 | |
| GPRIERYVMZVKTC-UHFFFAOYSA-N | |
| 1-phenyl-4-(4-phenylphenyl)benzene | |
| 8677 | |
| 306.41 | |
| ≥98.0% (HPLC) |
Chemical Identifiers
| 135-70-6 | |
| 306.408 | |
| GPRIERYVMZVKTC-UHFFFAOYSA-N | |
| 8677 | |
| 1-phenyl-4-(4-phenylphenyl)benzene |
| C24H18 | |
| MFCD00003062 | |
| p-quaterphenyl, 1,1':4',1:4,1'-quaterphenyl, benzerythrene, quadriphenyl, p-tetraphenyl, 4,4'-diphenylbiphenyl, p,p'-quaterphenyl, 4-quaterphenyl, unii-g8aqm6d0rk, 1-phenyl-4-4-phenylphenyl benzene | |
| CHEBI:52240 | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C4=CC=CC=C4 |
Safety and Handling
TSCA : Yes