missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Organic Carbon Standard, 50 ppm C, Ricca Chemical
Supplier: Ricca Chemical Company R18445001C
Specifications
| Organic Carbon Standard | |
| 877-24-7,7664-38-2,7732-18-5 | |
| 1 L | |
| 50.0 ± 0.5ppm | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 23676735 | |
| Aqueous Solution | |
| Liquid |
| 1mL = 0.050mg C, 50ppm C for Total Organic Carbon (TOC) | |
| Amber Glass Bottle | |
| Colorless to Yellow | |
| C8H5KO4 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.222 | |
| Odorless | |
| Infinitely soluble in water |
Chemical Identifiers
| 877-24-7 | |
| 204.222 | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| C8H5KO4 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate |