missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Oleic acid, sodium salt, 65-90% oleic C18, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 215080010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Oleic acid, sodium salt | |
| 143-19-1 | |
| Glass bottle | |
| CH3(CH2)7CH=CH(CH2)7CO2Na | |
| 1g | |
| 15, 6921 | |
| Solubility in water: soluble. Other solubilities: soluble in ethanol | |
| CCCCCCCCC=CCCCCCCCC(=O)[O-].[Na+] | |
| 304.44 | |
| CHEBI:81860 | |
| 65-90% oleic C18 |
| 65-90% oleic C18 | |
| Authentic | |
| C18H33NaO2 | |
| MFCD00004438 | |
| 02,I,198 | |
| sodium oleic acid | |
| BCKXLBQYZLBQEK-KVVVOXFISA-M | |
| sodium;(Z)-octadec-9-enoate | |
| 23665730 | |
| 304.44 |
Chemical Identifiers
| 143-19-1 | |
| 304.44 | |
| BCKXLBQYZLBQEK-KVVVOXFISA-M | |
| 23665730 | |
| sodium;(Z)-octadec-9-enoate |
| C18H33NaO2 | |
| MFCD00004438 | |
| sodium oleic acid | |
| CHEBI:81860 | |
| CCCCCCCCC=CCCCCCCCC(=O)[O-].[Na+] |
Safety and Handling
EINECSNumber : 205-591-
RUO â Research Use Only