missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
O-Methylisourea hemisulfate, 94%, ACROS Organics™
$111.61 - $111.61
Chemical Identifiers
| CAS | 52328-05-9 |
|---|---|
| Molecular Formula | 0·5 H2SO4 |
| Molecular Weight (g/mol) | 123.12 |
| MDL Number | MFCD00040594 |
| InChI Key | QSCPQKVWSNUJLJ-UHFFFAOYSA-N |
| Synonym | 0-methylisourea hemisulfate, 2-methylisouronium sulfate, bis 2-methylisouronium sulphate, bis methoxymethanimidamide ; sulfuric acid, carbamimidic acid, methyl ester, sulfate 2:1, o-methylisourea hemisulfate, o-methylisourea hemisulfate salt, o-methylisourea hemisulphate, o-methylpseudourea sulfate, omi™ |
| PubChem CID | 11357018 |
| IUPAC Name | methyl carbamimidate;sulfuric acid |
| SMILES | COC(=N)N.COC(=N)N.OS(=O)(=O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC233030250
|
Thermo Fisher Scientific
233030250 |
25g |
Each for $111.61
|
|
AC233032500
|
Thermo Fisher Scientific
233032500 |
250g |
N/A
|
N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
|
AC233030010
|
Thermo Fisher Scientific
AC233030010 |
1kg |
N/A
|
N/A | |||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 52328-05-9 | |
| 123.12 | |
| QSCPQKVWSNUJLJ-UHFFFAOYSA-N | |
| 11357018 | |
| COC(=N)N.COC(=N)N.OS(=O)(=O)O |
| 0·5 H2SO4 | |
| MFCD00040594 | |
| 0-methylisourea hemisulfate, 2-methylisouronium sulfate, bis 2-methylisouronium sulphate, bis methoxymethanimidamide ; sulfuric acid, carbamimidic acid, methyl ester, sulfate 2:1, o-methylisourea hemisulfate, o-methylisourea hemisulfate salt, o-methylisourea hemisulphate, o-methylpseudourea sulfate, omi™ | |
| methyl carbamimidate;sulfuric acid |
Specifications
| Plastic bottle | |
| 25g | |
| 92.0 | |
| 94% | |
| 0·5H2SO4 | |
| 0-methylisourea hemisulfate, 2-methylisouronium sulfate, bis 2-methylisouronium sulphate, bis methoxymethanimidamide ; sulfuric acid, carbamimidic acid, methyl ester, sulfate 2:1, o-methylisourea hemisulfate, o-methylisourea hemisulfate salt, o-methylisourea hemisulphate, o-methylpseudourea sulfate, omi™ | |
| QSCPQKVWSNUJLJ-UHFFFAOYSA-N | |
| methyl carbamimidate;sulfuric acid | |
| 11357018 | |
| 94% |
| 147°C to 153°C | |
| 52328-05-9 | |
| 100.0 | |
| 0·5 H2SO4 | |
| MFCD00040594 | |
| Solubility in water: 1000g/L water (20°C) | |
| COC(=N)N.COC(=N)N.OS(=O)(=O)O | |
| 123.12 | |
| 123.12 | |
| O-Methylisourea hemisulfate, 94% |
Safety and Handling
GHS Signal Word: Warning
EINECSNumber : 257-851-8