missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Nitrilotriacetic acid, 99%, ACROS Organics™
$56.26 - $202.07
Chemical Identifiers
| CAS | 139-13-9 |
|---|---|
| Molecular Formula | C6H9NO6 |
| Molecular Weight (g/mol) | 191.14 |
| MDL Number | MFCD00004287 |
| InChI Key | MGFYIUFZLHCRTH-UHFFFAOYSA-N |
| Synonym | 2,2',2-nitrilotriacetic acid, aminotriacetic acid, complexon i, komplexon i, n,n-bis carboxymethyl glycine, nitrilotriacetate, nitrilotriacetic acid, titriplex i, triglycollamic acid, trilon a |
| PubChem CID | 8758 |
| ChEBI | CHEBI:44557 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]acetic acid |
| SMILES | C(C(=O)O)N(CC(=O)O)CC(=O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC415740050
|
Thermo Fisher Scientific
415740050 |
5g | Glass Bottle |
Each for $56.26
|
|
AC415742500
|
Fisher Scientific Acros
415742500 |
250g | Plastic bottle |
Each for $77.25
|
|
AC415740010
|
Thermo Fisher Scientific
415740010 |
1kg | Plastic bottle |
Each for $202.07
|
|
AC415740051
|
Thermo Fisher Scientific
AC415740051 |
5kg | Plastic drum |
N/A
|
N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 139-13-9 | |
| 191.14 | |
| MGFYIUFZLHCRTH-UHFFFAOYSA-N | |
| 8758 | |
| 2-[bis(carboxymethyl)amino]acetic acid |
| C6H9NO6 | |
| MFCD00004287 | |
| 2,2',2-nitrilotriacetic acid, aminotriacetic acid, complexon i, komplexon i, n,n-bis carboxymethyl glycine, nitrilotriacetate, nitrilotriacetic acid, titriplex i, triglycollamic acid, trilon a | |
| CHEBI:44557 | |
| C(C(=O)O)N(CC(=O)O)CC(=O)O |
Specifications
| Authentic | |
| White | |
| 5g | |
| 98.5 | |
| 99% | |
| N(CH2CO2H)3 | |
| 04,369 | |
| 2,2',2-nitrilotriacetic acid, aminotriacetic acid, complexon i, komplexon i, n,n-bis carboxymethyl glycine, nitrilotriacetate, nitrilotriacetic acid, titriplex i, triglycollamic acid, trilon a | |
| MGFYIUFZLHCRTH-UHFFFAOYSA-N | |
| 2-[bis(carboxymethyl)amino]acetic acid | |
| 8758 | |
| 191.14 | |
| 99% |
| Glass Bottle | |
| 245.0°C | |
| 139-13-9 | |
| 100.0 | |
| C6H9NO6 | |
| MFCD00004287 | |
| 15,6665 | |
| Solubility in water: 1.28g/L (22.5°C). Other solubilities: soluble in most common organic solvents | |
| C(C(=O)O)N(CC(=O)O)CC(=O)O | |
| 191.14 | |
| CHEBI:44557 | |
| Crystalline Powder | |
| Nitrilotriacetic acid, 99% |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Suspected of causing cancer if swallowed.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Obtain special instructions before use.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy
GHS Signal Word: Warning
EINECSNumber : 205-355-7
RTECSNumber : AJ0175000
TSCA : TSCA