Learn More
Nerolidol, cis + trans, 97+%
CAS: 7212-44-4 | C15H26O | 222.37 g/mol
Supplier: Thermo Scientific Chemicals A1881214
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Nerolidol | |
| 7212-44-4 | |
| 263°C to 266°C | |
| C15H26O | |
| MFCD00008911,MFCD00008911,MFCD00008911,MFCD00085350 | |
| 1724135 | |
| 3r,6e-nerolidol, unii-uoc0644v25, 3r-6e-nerolidol, nerolidol, 3r,6e-3,7,11-trimethyldodeca-1,6,10-trien-3-ol, e-nerolidol, 1,6,10-dodecatrien-3-ol, 3,7,11-trimethyl-, 3r,6e, nerolidol, 6e--, --nerolidol, ?-nerolidol | |
| CC(C)=CCC\C(C)=C\CCC(C)(O)C=C | |
| 222.37 | |
| CHEBI:59959 | |
| ≥97% |
| cis + trans | |
| 0.876 | |
| 96°C (204°F) | |
| 1.479 | |
| 25 g | |
| 14,6477 | |
| FQTLCLSUCSAZDY-SDNWHVSQNA-N | |
| (3R,6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol | |
| 11241545 | |
| 222.37 |
Chemical Identifiers
| 7212-44-4 | |
| 222.37 | |
| FQTLCLSUCSAZDY-SDNWHVSQNA-N | |
| 11241545 | |
| CC(C)=CCC\C(C)=C\CCC(C)(O)C=C |
| C15H26O | |
| MFCD00008911,MFCD00008911,MFCD00008911,MFCD00085350 | |
| 3r,6e-nerolidol, unii-uoc0644v25, 3r-6e-nerolidol, nerolidol, 3r,6e-3,7,11-trimethyldodeca-1,6,10-trien-3-ol, e-nerolidol, 1,6,10-dodecatrien-3-ol, 3,7,11-trimethyl-, 3r,6e, nerolidol, 6e--, --nerolidol, ?-nerolidol | |
| CHEBI:59959 |
Safety and Handling
P264b-P280i-P305+P351+P338
H319
DOTInformation : Hazard Class: 9; Packaging Group: III
EINECSNumber : 230-597-5
RTECSNumber : JR4977000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only