missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
N-(tert-Butoxycarbonyloxy)succinimide, 97%, Acros Organics
Manufacturer: Thermo Fisher Scientific AC436240250
Specifications
| N-(tert-Butoxycarbonyloxy)succinimide | |
| Authentic | |
| White | |
| 25g | |
| 97.5 | |
| 97% | |
| 1-tert-butoxycarbonyl oxy pyrrolidine-2,5-dione | |
| CC(C)(C)OC(=O)ON1C(=O)CCC1=O | |
| 215.21 | |
| 215.21 | |
| 97% |
| 48.22 to 52.24% C, 6.25 to 6.77% N | |
| Glass Bottle | |
| 88°C to 91°C | |
| 13139-12-3 | |
| 100.0 | |
| C9H13NO5 | |
| VTGFSVGZCYYHLO-UHFFFAOYSA-N | |
| tert-butyl (2,5-dioxopyrrolidin-1-yl) carbonate | |
| 83168 | |
| Powder |
Chemical Identifiers
| 13139-12-3 | |
| 215.21 | |
| 1-tert-butoxycarbonyl oxy pyrrolidine-2,5-dione | |
| tert-butyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| C9H13NO5 | |
| VTGFSVGZCYYHLO-UHFFFAOYSA-N | |
| 83168 | |
| CC(C)(C)OC(=O)ON1C(=O)CCC1=O |
Safety and Handling
GHS H Statement
Harmful if swallowed.
May cause an allergic skin reaction.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present a
GHS Signal Word: Warning
EINECSNumber : 236-071-1