missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
N-(tert-Butoxycarbonyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline 99.0+%, TCI America™
Supplier: TCI America B55885G
Specifications
| N-(tert-Butoxycarbonyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline | |
| 170°C | |
| C17H26BNO4 | |
| 5 g | |
| HSJNIOYPTSKQBD-UHFFFAOYSA-N | |
| tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate | |
| 2734617 | |
| ≥99.0% (HPLC,T) |
| 330793-01-6 | |
| White | |
| MFCD02179439 | |
| 4-n-boc-amino phenylboronic acid pinacol ester, tert-butyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl carbamate, 4-boc-amino benzeneboronic acid pinacol ester, tert-butyl n-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl carbamate, 4-boc-amino phenylboronic acid pinacol cyclic ester, 4-boc-aminophenylboronic acid, pinacol ester, 4-tert-butoxycarbonyl aminophenylboronic acid, pinacol ester, tert-butyl n-4-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl carbamate, tert-butyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenylcarbamate | |
| CC(C)(C)OC(=O)NC1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1 | |
| 319.21 | |
| 319.21 | |
| Crystalline Powder |
Chemical Identifiers
| 330793-01-6 | |
| 319.21 | |
| HSJNIOYPTSKQBD-UHFFFAOYSA-N | |
| 2734617 | |
| CC(C)(C)OC(=O)NC1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1 |
| C17H26BNO4 | |
| MFCD02179439 | |
| 4-n-boc-amino phenylboronic acid pinacol ester, tert-butyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl carbamate, 4-boc-amino benzeneboronic acid pinacol ester, tert-butyl n-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl carbamate, 4-boc-amino phenylboronic acid pinacol cyclic ester, 4-boc-aminophenylboronic acid, pinacol ester, 4-tert-butoxycarbonyl aminophenylboronic acid, pinacol ester, tert-butyl n-4-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl carbamate, tert-butyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenylcarbamate | |
| tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
Safety and Handling
TSCA : No