missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
N-BOC-N,2-Dimethylalanine, 98+%, ACROS Organics™
Chemical Identifiers
| CAS | 146000-39-7 |
|---|---|
| Molecular Formula | C10H19NO4 |
| Molecular Weight (g/mol) | 217.26 |
| MDL Number | MFCD01862912 |
| InChI Key | KPDLITGXUYMJEC-UHFFFAOYSA-N |
| Synonym | 2-methyl-2-methyl-2-methylpropan-2-yl oxycarbonyl amino propanoic acid |
| PubChem CID | 2734752 |
| IUPAC Name | 2-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N(C)C(C)(C)C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC370950010 SDS |
Thermo Fisher Scientific
AC370950010 |
1g | Glass bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
| AC370950050 SDS |
Thermo Fisher Scientific
AC370950050 |
5g | Glass bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 146000-39-7 | |
| 217.26 | |
| KPDLITGXUYMJEC-UHFFFAOYSA-N | |
| 2734752 | |
| CC(C)(C)OC(=O)N(C)C(C)(C)C(=O)O |
| C10H19NO4 | |
| MFCD01862912 | |
| 2-methyl-2-methyl-2-methylpropan-2-yl oxycarbonyl amino propanoic acid | |
| 2-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
Specifications
| Authentic | |
| White | |
| 1g | |
| 98.0 | |
| 98+% | |
| (CH3)3COCON(CH3)C(CH3)2COOH | |
| 2-methyl-2-methyl-2-methylpropan-2-yl oxycarbonyl amino propanoic acid | |
| CC(C)(C)OC(=O)N(C)C(C)(C)C(=O)O | |
| 217.26 | |
| 217.26 | |
| 98+% |
| Glass bottle | |
| 153°C to 157°C | |
| 146000-39-7 | |
| 100.0 | |
| C10H19NO4 | |
| MFCD01862912 | |
| KPDLITGXUYMJEC-UHFFFAOYSA-N | |
| 2-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid | |
| 2734752 | |
| Crystalline Powder | |
| N-BOC-N, 2-Dimethylalanine |
Safety and Handling
Recommended Storage : Refrigerator +4°C