missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
N-Acetyl-L-tyrosine Ethyl Ester Monohydrate 98.0+%, TCI America™
Supplier: TCI America A01181G
Specifications
| N-Acetyl-L-tyrosine Ethyl Ester Monohydrate | |
| 81°C | |
| C13H19NO5 | |
| 1 g | |
| YWAVLHZJMWEYTA-HVPILOLGNA-N | |
| ethyl (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate hydrate | |
| 2723594 | |
| ≥98.0% (HPLC,N) |
| 36546-50-6 | |
| White-Yellow | |
| MFCD00149093 | |
| n-acetyl-l-tyrosine ethyl ester monohydrate, ethyl n-acetyl-l-tyrosinate hydrate, ac-tyr-oet.h2o, atee, ethyl 2s-2-acetamido-3-4-hydroxyphenyl propanoate hydrate, n-acetyl-l-tyrosineethylestermonohydrate, n-acetyltyrosine ethyl ester monohydrate, ksc491m4n, n-acetyl tyrosine ethyl ester mono hydrate, acetyl-l-tyrosine ethyl ester hydrate | |
| O.CCOC(=O)[C@H](CC1=CC=C(O)C=C1)NC(C)=O | |
| 269.30 | |
| 251.28 | |
| Crystalline Powder |
Chemical Identifiers
| 36546-50-6 | |
| 269.30 | |
| YWAVLHZJMWEYTA-HVPILOLGNA-N | |
| 2723594 | |
| O.CCOC(=O)[C@H](CC1=CC=C(O)C=C1)NC(C)=O |
| C13H19NO5 | |
| MFCD00149093 | |
| n-acetyl-l-tyrosine ethyl ester monohydrate, ethyl n-acetyl-l-tyrosinate hydrate, ac-tyr-oet.h2o, atee, ethyl 2s-2-acetamido-3-4-hydroxyphenyl propanoate hydrate, n-acetyl-l-tyrosineethylestermonohydrate, n-acetyltyrosine ethyl ester monohydrate, ksc491m4n, n-acetyl tyrosine ethyl ester mono hydrate, acetyl-l-tyrosine ethyl ester hydrate | |
| ethyl (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate hydrate |
Safety and Handling
TSCA : Yes