missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Molecular sieves 4A, pellets, 3.2mm diameter, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC436730010
Description
Drying agentSpecifications
| 650 to 750g/L | |
| Plastic Bottle | |
| > 20% (55% rH, 20°C) | |
| 1kg | |
| C20H25FN2O8 | |
| CC(C(C(=O)OC)C(=O)OC)C(C(=O)O)NC(=O)C(CC1=CC(=CC=C1)F)NC(=O)C | |
| 440.424 | |
| Cylinders |
| Molecular sieves 4A | |
| < 2% (900°C, 2 hrs.) | |
| Beige | |
| 70955-01-0 | |
| FJUZEZRZKVMAMD-DRZCJDIDSA-N | |
| (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentanoic acid | |
| 73906282 |
Chemical Identifiers
| 70955-01-0 | |
| 440.424 | |
| 73906282 | |
| CC(C(C(=O)OC)C(=O)OC)C(C(=O)O)NC(=O)C(CC1=CC(=CC=C1)F)NC(=O)C |
| C20H25FN2O8 | |
| FJUZEZRZKVMAMD-DRZCJDIDSA-N | |
| (2R,3S)-2-[[(2R)-2-acetamido-3-(3-fluorophenyl)propanoyl]amino]-5-methoxy-4-methoxycarbonyl-3-methyl-5-oxopentanoic acid |