missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Alfa Aesar™ Mezlocillin sodium salt
A broad spectrum antibiotic
Manufacturer: Alfa Aesar™ J66306MC
Specifications
| Mezlocillin sodium salt | |
| C21H25N5NaO8S2 | |
| Soluble in water or DMSO | |
| CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)NC(=O)N4CCN(C4=O)S(=O)(=O)C)C(=O)O)C.[Na] | |
| 562.568 | |
| 561.56 | |
| White to Yellow |
| 59798-30-0 | |
| MFCD07793332 | |
| SGVORSZSYKDVFT-KZHFGBRHSA-N | |
| (2R,5S,6S)-3,3-dimethyl-6-[[(2R)-2-[(3-methylsulfonyl-2-oxoimidazolidine-1-carbonyl)amino]-2-phenylacetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;sodium | |
| 123133909 | |
| Powder | |
| 100mg |
Chemical Identifiers
| 59798-30-0 | |
| 562.568 | |
| SGVORSZSYKDVFT-KZHFGBRHSA-N | |
| (2R,5S,6S)-3,3-dimethyl-6-[[(2R)-2-[(3-methylsulfonyl-2-oxoimidazolidine-1-carbonyl)amino]-2-phenylacetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;sodium |
| C21H25N5NaO8S2 | |
| MFCD07793332 | |
| 123133909 | |
| CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)NC(=O)N4CCN(C4=O)S(=O)(=O)C)C(=O)O)C.[Na] |
Safety and Handling
storageNote1 : 2° to 8°C