missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl vanillate, 99%, Acros Organics™
Chemical Identifiers
| CAS | 3943-74-6 |
|---|---|
| Molecular Formula | C9H10O4 |
| Molecular Weight (g/mol) | 182.175 |
| MDL Number | MFCD00008438 |
| InChI Key | BVWTXUYLKBHMOX-UHFFFAOYSA-N |
| Synonym | methyl vanillate, methyl 3-methoxy-4-hydroxybenzoate, vanillic acid, methyl ester, 4-hydroxy-3-methoxybenzoic acid methyl ester, methylvanillate, benzoic acid, 4-hydroxy-3-methoxy-, methyl ester, vanillic acid methyl ester, unii-2hxg8qso3d, 2hxg8qso3d, vxx |
| PubChem CID | 19844 |
| ChEBI | CHEBI:46477 |
| IUPAC Name | methyl 4-hydroxy-3-methoxybenzoate |
| SMILES | COC1=C(C=CC(=C1)C(=O)OC)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC160301000 SDS |
Acros Organics
AC160301000 |
100g | Glass bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
| AC160300050 SDS |
Acros Organics
160300050 |
5g | Glass bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
| AC160300250 SDS |
Acros Organics
160300250 |
25g | Glass bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 3943-74-6 | |
| 182.175 | |
| BVWTXUYLKBHMOX-UHFFFAOYSA-N | |
| 19844 | |
| methyl 4-hydroxy-3-methoxybenzoate |
| C9H10O4 | |
| MFCD00008438 | |
| methyl vanillate, methyl 3-methoxy-4-hydroxybenzoate, vanillic acid, methyl ester, 4-hydroxy-3-methoxybenzoic acid methyl ester, methylvanillate, benzoic acid, 4-hydroxy-3-methoxy-, methyl ester, vanillic acid methyl ester, unii-2hxg8qso3d, 2hxg8qso3d, vxx | |
| CHEBI:46477 | |
| COC1=C(C=CC(=C1)C(=O)OC)O |
Specifications
| Authentic | |
| 285.0°C to 287.0°C | |
| 64.0°C to 67.0°C | |
| 3943-74-6 | |
| C9H10O4 | |
| MFCD00008438 | |
| methyl vanillate, methyl 3-methoxy-4-hydroxybenzoate, vanillic acid, methyl ester, 4-hydroxy-3-methoxybenzoic acid methyl ester, methylvanillate, benzoic acid, 4-hydroxy-3-methoxy-, methyl ester, vanillic acid methyl ester, unii-2hxg8qso3d, 2hxg8qso3d, vxx | |
| COC1=C(C=CC(=C1)C(=O)OC)O | |
| 182.175 | |
| CHEBI:46477 | |
| Powder and Granules | |
| Methyl vanillate |
| Glass bottle | |
| Beige to Yellow | |
| 100g | |
| 99% | |
| HOC6H3(OCH3)CO2CH3 | |
| 10, 396 | |
| BVWTXUYLKBHMOX-UHFFFAOYSA-N | |
| methyl 4-hydroxy-3-methoxybenzoate | |
| 19844 | |
| 182.18 | |
| 99% |