missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl 4-fluorobenzoylacetate, 99%, ACROS Organics™
Chemical Identifiers
| CAS | 63131-29-3 |
|---|---|
| Molecular Formula | C10H9FO3 |
| Molecular Weight (g/mol) | 196.18 |
| MDL Number | MFCD00000355 |
| InChI Key | HGLVYXXPRSNKQN-UHFFFAOYSA-N |
| Synonym | 3-4-fluoro-phenyl-3-oxo-propionic acid methyl ester, 4-fluorobenzoylacetic acid methyl ester, acmc-209nd6, benzenepropanoic acid, 4-fluoro-.beta.-oxo-, methyl ester, benzenepropanoic acid, 4-fluoro-beta-oxo-, methyl ester, methyl 3-4-fluorophenyl-3-oxopropanoate, methyl 4'-fluorobenzoylacetate, methyl 4-fluorobenzoylacetate, methyl p-fluorobenzoylacetate, pubchem16721 |
| PubChem CID | 579425 |
| IUPAC Name | methyl 3-(4-fluorophenyl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)C1=CC=C(C=C1)F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC199760100
|
Fisher Scientific Acros
199760100 |
10g | Glass bottle |
N/A
|
N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
|
AC199760250
|
Thermo Fisher Scientific
AC199760250 |
25g | Glass bottle |
N/A
|
N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 63131-29-3 | |
| 196.18 | |
| HGLVYXXPRSNKQN-UHFFFAOYSA-N | |
| 579425 | |
| COC(=O)CC(=O)C1=CC=C(C=C1)F |
| C10H9FO3 | |
| MFCD00000355 | |
| 3-4-fluoro-phenyl-3-oxo-propionic acid methyl ester, 4-fluorobenzoylacetic acid methyl ester, acmc-209nd6, benzenepropanoic acid, 4-fluoro-.beta.-oxo-, methyl ester, benzenepropanoic acid, 4-fluoro-beta-oxo-, methyl ester, methyl 3-4-fluorophenyl-3-oxopropanoate, methyl 4'-fluorobenzoylacetate, methyl 4-fluorobenzoylacetate, methyl p-fluorobenzoylacetate, pubchem16721 | |
| methyl 3-(4-fluorophenyl)-3-oxopropanoate |
Specifications
| 1.2200g/mL | |
| Authentic | |
| 1.5200 to 1.522 | |
| Colorless to Yellow | |
| 63131-29-3 | |
| C10H9FO3 | |
| MFCD00000355 | |
| HGLVYXXPRSNKQN-UHFFFAOYSA-N | |
| methyl 3-(4-fluorophenyl)-3-oxopropanoate | |
| 579425 | |
| Liquid | |
| Methyl 4-fluorobenzoylacetate |
| >112°C | |
| Glass bottle | |
| 1.22 | |
| 10g | |
| 99% | |
| FC6H4COCH2CO2CH3 | |
| 3-4-fluoro-phenyl-3-oxo-propionic acid methyl ester, 4-fluorobenzoylacetic acid methyl ester, acmc-209nd6, benzenepropanoic acid, 4-fluoro-.beta.-oxo-, methyl ester, benzenepropanoic acid, 4-fluoro-beta-oxo-, methyl ester, methyl 3-4-fluorophenyl-3-oxopropanoate, methyl 4'-fluorobenzoylacetate, methyl 4-fluorobenzoylacetate, methyl p-fluorobenzoylacetate, pubchem16721 | |
| COC(=O)CC(=O)C1=CC=C(C=C1)F | |
| 196.18 | |
| 196.18 | |
| 99% |
Safety and Handling
EINECSNumber : 263-889-6