Learn More
Methyldiphenylphosphine, 99%, ACROS Organics™
$90.82 - $270.00
Chemical Identifiers
| CAS | 1486-28-8 |
|---|---|
| Molecular Formula | C13H13P |
| Molecular Weight (g/mol) | 200.221 |
| MDL Number | MFCD00008508 |
| InChI Key | UJNZOIKQAUQOCN-UHFFFAOYSA-N |
| Synonym | methyldiphenylphosphine, diphenylmethylphosphine, methyl diphenyl phosphine, phosphine, methyldiphenyl, methyldiphenylphsphine, diphenylphosphinomethane, methyldiphenylphoshine, pubchem6421, methyl diphenylphosphine, methyldi-phenylphosphine |
| PubChem CID | 73879 |
| IUPAC Name | methyl(diphenyl)phosphane |
| SMILES | CP(C1=CC=CC=C1)C2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC408971000 SDS |
Acros Organics
AC408971000 |
100g | Glass bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
| AC408970050 SDS |
Acros Organics
408970050 |
5g | Glass bottle |
Each for $90.82
|
|
AC408970250 SDS |
Acros Organics
408970250 |
25g | Glass bottle |
Each for $270.00
|
|
Chemical Identifiers
| 1486-28-8 | |
| 200.221 | |
| UJNZOIKQAUQOCN-UHFFFAOYSA-N | |
| 73879 | |
| CP(C1=CC=CC=C1)C2=CC=CC=C2 |
| C13H13P | |
| MFCD00008508 | |
| methyldiphenylphosphine, diphenylmethylphosphine, methyl diphenyl phosphine, phosphine, methyldiphenyl, methyldiphenylphsphine, diphenylphosphinomethane, methyldiphenylphoshine, pubchem6421, methyl diphenylphosphine, methyldi-phenylphosphine | |
| methyl(diphenyl)phosphane |
Specifications
| 1.0760g/mL | |
| Authentic | |
| 1.6240 to 1.6260 | |
| 118.0°C to 120.0°C (2.2 mmHg) | |
| 100g | |
| 99% | |
| (C6H5)2PCH3 | |
| 16, II, 371 | |
| UJNZOIKQAUQOCN-UHFFFAOYSA-N | |
| methyl(diphenyl)phosphane | |
| 73879 | |
| Liquid | |
| Methyldiphenylphosphine |
| >110°C | |
| Glass bottle | |
| 1.076 | |
| Colorless to Yellow | |
| 1486-28-8 | |
| C13H13P | |
| MFCD00008508 | |
| methyldiphenylphosphine, diphenylmethylphosphine, methyl diphenyl phosphine, phosphine, methyldiphenyl, methyldiphenylphsphine, diphenylphosphinomethane, methyldiphenylphoshine, pubchem6421, methyl diphenylphosphine, methyldi-phenylphosphine | |
| CP(C1=CC=CC=C1)C2=CC=CC=C2 | |
| 200.221 | |
| 200.22 | |
| 99% |
Safety and Handling
GHS H Statement:
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement:
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.