missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl Tricosafluorododecanoate 95.0+%, TCI America™
Supplier: TCI America M19175G
Specifications
| Methyl Tricosafluorododecanoate | |
| 58°C | |
| 125°C | |
| MFCD00236616 | |
| methyl perfluorododecanoate, methyl tricosafluorododecanoate, tricosafluorododecanoic acid methyl ester, dodecanoic acid, tricosafluoro-, methyl ester, methyl tricosafluorolaurate, acmc-1b030, perfluorododecanoic acid methyl ester, methyl tricosafluorolaurate; perfluorododecanoic acid methyl ester, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoic acid methyl ester | |
| COC(=O)C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F | |
| 628.128 | |
| 628.13 | |
| Crystalline Powder |
| 56554-52-0 | |
| White-Yellow | |
| C13H3F23O2 | |
| 5 g | |
| ABNZIVVYHQYSLI-UHFFFAOYSA-N | |
| methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoate | |
| 547885 | |
| ≥95.0% (GC) |
Chemical Identifiers
| 56554-52-0 | |
| 628.128 | |
| ABNZIVVYHQYSLI-UHFFFAOYSA-N | |
| 547885 | |
| COC(=O)C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| C13H3F23O2 | |
| MFCD00236616 | |
| methyl perfluorododecanoate, methyl tricosafluorododecanoate, tricosafluorododecanoic acid methyl ester, dodecanoic acid, tricosafluoro-, methyl ester, methyl tricosafluorolaurate, acmc-1b030, perfluorododecanoic acid methyl ester, methyl tricosafluorolaurate; perfluorododecanoic acid methyl ester, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoic acid methyl ester | |
| methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoate |
Safety and Handling
TSCA : No