missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl Caffeate 98.0+%, TCI America™
Supplier: TCI America M2519200MG
Specifications
| Methyl Caffeate | |
| 160°C | |
| MFCD00210468 | |
| methyl caffeate, methyl 3-3,4-dihydroxyphenyl acrylate, caffeic acid methyl ester, e-methyl 3-3,4-dihydroxyphenyl acrylate, methylcaffeate, methyl 3,4-dihydroxycinnamate, caffeic acid, methyl ester, unii-n79173b9hf, methyl 2e-3-3,4-dihydroxyphenyl prop-2-enoate, chembl17001 | |
| COC(=O)C=CC1=CC(=C(C=C1)O)O | |
| 194.186 | |
| CHEBI:6856 | |
| ≥98.0% (GC,T) |
| 3843-74-1 | |
| C10H10O4 | |
| 200 mg | |
| OCNYGKNIVPVPPX-HWKANZROSA-N | |
| methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate | |
| 689075 | |
| 194.19 | |
| Crystalline Powder |
Chemical Identifiers
| 3843-74-1 | |
| 194.186 | |
| OCNYGKNIVPVPPX-HWKANZROSA-N | |
| 689075 | |
| methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| C10H10O4 | |
| MFCD00210468 | |
| methyl caffeate, methyl 3-3,4-dihydroxyphenyl acrylate, caffeic acid methyl ester, e-methyl 3-3,4-dihydroxyphenyl acrylate, methylcaffeate, methyl 3,4-dihydroxycinnamate, caffeic acid, methyl ester, unii-n79173b9hf, methyl 2e-3-3,4-dihydroxyphenyl prop-2-enoate, chembl17001 | |
| CHEBI:6856 | |
| COC(=O)C=CC1=CC(=C(C=C1)O)O |
Safety and Handling
TSCA : No