missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl 4-hydroxybenzoate, sodium salt, 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC235140025
Specifications
| Methyl 4-hydroxybenzoate, sodium salt | |
| Authentic | |
| 5% max. (K.F.) | |
| >125°C | |
| 99% | |
| 99% | |
| MFCD00016470 | |
| bonomold omna, methyl 4-hydroxybenzoate sodium salt, methyl 4-hydroxybenzoate, sodium salt, methylparaben sodium, preserval ms, sodium 4-carbomethoxyphenolate, sodium 4-methoxycarbonyl phenolate, sodium methylparaben, solparol, unii-cr6k9c2nhk | |
| PESXGULMKCKJCC-UHFFFAOYSA-M | |
| sodium;4-methoxycarbonylphenolate | |
| 23663626 | |
| Powder |
| >100°C | |
| Plastic bottle | |
| White | |
| 2.5kg | |
| 5026-62-0 | |
| C8H7NaO3 | |
| 10,5977 | |
| Solubility in water: 333g/L (20°C) | |
| COC(=O)C1=CC=C(C=C1)[O-].[Na+] | |
| 174.13 | |
| 174.13 | |
| 99% |
Chemical Identifiers
| 5026-62-0 | |
| 174.13 | |
| PESXGULMKCKJCC-UHFFFAOYSA-M | |
| 23663626 | |
| COC(=O)C1=CC=C(C=C1)[O-].[Na+] |
| C8H7NaO3 | |
| MFCD00016470 | |
| bonomold omna, methyl 4-hydroxybenzoate sodium salt, methyl 4-hydroxybenzoate, sodium salt, methylparaben sodium, preserval ms, sodium 4-carbomethoxyphenolate, sodium 4-methoxycarbonyl phenolate, sodium methylparaben, solparol, unii-cr6k9c2nhk | |
| sodium;4-methoxycarbonylphenolate |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye damage.
Harmful to aquatic life with long lasting effects.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
GHS Signal Word: Danger
EINECSNumber : 225-714-1
RTECSNumber : DH2455000