Learn More
Methyl 4-hydroxybenzoate, sodium salt, 99%, ACROS Organics™
Manufacturer: Acros Organics AC235140025
Specifications
| Methyl 4-hydroxybenzoate, sodium salt | |
| Plastic bottle | |
| White | |
| 99% | |
| 99% | |
| MFCD00016470 | |
| PESXGULMKCKJCC-UHFFFAOYSA-M | |
| sodium;4-methoxycarbonylphenolate | |
| 23663626 | |
| Powder |
| Authentic | |
| 5% max. (K.F.) | |
| 2.5kg | |
| 5026-62-0 | |
| C8H7NaO3 | |
| bonomold omna | |
| COC(=O)C1=CC=C(C=C1)[O-].[Na+] | |
| 174.131 | |
| 174.13 | |
| ≥98.5% (on anhydrous substance) |
Chemical Identifiers
| 5026-62-0 | |
| 174.131 | |
| PESXGULMKCKJCC-UHFFFAOYSA-M | |
| 23663626 | |
| COC(=O)C1=CC=C(C=C1)[O-].[Na+] |
| C8H7NaO3 | |
| MFCD00016470 | |
| bonomold omna | |
| sodium;4-methoxycarbonylphenolate |
Safety and Handling
GHS H Statement:
Causes serious eye irritation.
GHS P Statement:
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
Warning
EINECSNumber : 225-714-1
RTECSNumber : DH2455000