missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl 3,4-Dimethoxybenzoate 98.0+%, TCI America™
Supplier: TCI America M28055G
Specifications
Methyl 3,4-Dimethoxybenzoate | |
60°C | |
283°C | |
MFCD00008430 | |
methyl veratrate, benzoic acid, 3,4-dimethoxy-, methyl ester, 3,4-dimethoxybenzoic acid methyl ester, veratric acid, methyl ester, methylveratrate, pubchem13009, acmc-1cfay, veratric acid methyl ester, methyl 3,4 dimethoxybenzoate, methyl 3, 4-dimethoxybenzoate | |
COC(=O)C1=CC=C(OC)C(OC)=C1 | |
196.20 | |
CHEBI:86906 | |
≥98.0% (GC) |
2150-38-1 | |
White-Yellow | |
C10H12O4 | |
5 g | |
BIGQPYZPEWAPBG-UHFFFAOYSA-N | |
methyl 3,4-dimethoxybenzoate | |
16522 | |
196.20 | |
Crystalline Powder |
Chemical Identifiers
2150-38-1 | |
196.20 | |
BIGQPYZPEWAPBG-UHFFFAOYSA-N | |
16522 | |
methyl 3,4-dimethoxybenzoate |
C10H12O4 | |
MFCD00008430 | |
methyl veratrate, benzoic acid, 3,4-dimethoxy-, methyl ester, 3,4-dimethoxybenzoic acid methyl ester, veratric acid, methyl ester, methylveratrate, pubchem13009, acmc-1cfay, veratric acid methyl ester, methyl 3,4 dimethoxybenzoate, methyl 3, 4-dimethoxybenzoate | |
CHEBI:86906 | |
COC(=O)C1=CC=C(OC)C(OC)=C1 |
Safety and Handling
TSCA : Yes