missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate 98.0+%, TCI America™
Supplier: TCI America M26655G
Specifications
| Methyl 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate | |
| 95°C | |
| C14H19BO4 | |
| 5 g | |
| JBJGSVBGUBATNH-UHFFFAOYSA-N | |
| methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate | |
| 2734651 | |
| ≥98.0% (GC,T) |
| 480425-35-2 | |
| White | |
| MFCD03789258 | |
| 3-methoxycarbonylphenylboronic acid pinacol ester, methyl 3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 3-methoxycarbonylphenylboronic acid, pinacol ester, 3-methoxycarbonyl phenylboronic acid pinacol ester, methyl 3-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, benzoic acid, 3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-, methyl ester, pubchem9527, 3-carbomethoxyphenylboronic acid pinacol ester, 3-methoxycarbonyl phenyl boronic acid pinacol ester | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)OC | |
| 262.112 | |
| 262.11 | |
| Crystalline Powder |
Chemical Identifiers
| 480425-35-2 | |
| 262.112 | |
| JBJGSVBGUBATNH-UHFFFAOYSA-N | |
| 2734651 | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)OC |
| C14H19BO4 | |
| MFCD03789258 | |
| 3-methoxycarbonylphenylboronic acid pinacol ester, methyl 3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 3-methoxycarbonylphenylboronic acid, pinacol ester, 3-methoxycarbonyl phenylboronic acid pinacol ester, methyl 3-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, benzoic acid, 3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-, methyl ester, pubchem9527, 3-carbomethoxyphenylboronic acid pinacol ester, 3-methoxycarbonyl phenyl boronic acid pinacol ester | |
| methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
Safety and Handling
TSCA : No