missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
m-Nitrophenol, 99.9%, For GC analysis, MP Biomedicals™
Manufacturer: Mp Biomedicals 0215589380
Specifications
| m-Nitrophenol | |
| 100g | |
| 554-84-7 | |
| 1-hydroxy-3-nitrobenzene, 3-hydroxynitrobenzene, 3-nitro-phenol, m-hydroxynitrobenzene, m-nitrofenol, m-nitrofenol czech, m-nitrophenol, meta-nitrophenol, phenol, 3-nitro, phenol, m-nitro | |
| C1=CC(=CC(=C1)O)[N+](=O)[O-] | |
| 139.11 | |
| CHEBI:34346 | |
| Crystalline Powder |
| Red-Yellow | |
| For GC analysis | |
| C6H5NO3 | |
| RTZZCYNQPHTPPL-UHFFFAOYSA-N | |
| 3-nitrophenol | |
| 11137 | |
| 139.11 | |
| 0.999 |
Chemical Identifiers
| 554-84-7 | |
| 139.11 | |
| 1-hydroxy-3-nitrobenzene, 3-hydroxynitrobenzene, 3-nitro-phenol, m-hydroxynitrobenzene, m-nitrofenol, m-nitrofenol czech, m-nitrophenol, meta-nitrophenol, phenol, 3-nitro, phenol, m-nitro | |
| CHEBI:34346 | |
| C1=CC(=CC(=C1)O)[N+](=O)[O-] |
| C6H5NO3 | |
| RTZZCYNQPHTPPL-UHFFFAOYSA-N | |
| 11137 | |
| 3-nitrophenol |