missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Lithium bis(trimethylsilyl)amide, 95%, ACROS Organics™
$43.95 - $459.43
Chemical Identifiers
| CAS | 4039-32-1 |
|---|---|
| Molecular Formula | C6H18LiNSi2 |
| Molecular Weight (g/mol) | 167.33 |
| MDL Number | MFCD00008261 |
| InChI Key | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Synonym | hexamethyldisilazane lithium salt, lhmds, lihmds, lithium bis trimethylsilyl amide, lithium bis trimethylsilyl azanide, lithium bis-trimethylsilyl amide, lithium hexamethyldisilazane, lithium hexamethyldisilazide, lithiumbis trimethylsilyl amide, unii-rc4n1i108m |
| PubChem CID | 2733832 |
| IUPAC Name | lithium;bis(trimethylsilyl)azanide |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC338140100
|
Thermo Fisher Scientific
338140100 |
10g | Glass bottle |
Each for $43.95
|
|
AC338140500
|
Thermo Fisher Scientific
AC338140500 |
50g | Glass bottle |
Each for $127.35
|
|
AC338142500
|
Thermo Fisher Scientific
AC338142500 |
250g | Glass bottle |
Each for $459.43
|
|
Chemical Identifiers
| 4039-32-1 | |
| 167.33 | |
| YNESATAKKCNGOF-UHFFFAOYSA-N | |
| 2733832 | |
| [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| C6H18LiNSi2 | |
| MFCD00008261 | |
| hexamethyldisilazane lithium salt, lhmds, lihmds, lithium bis trimethylsilyl amide, lithium bis trimethylsilyl azanide, lithium bis-trimethylsilyl amide, lithium hexamethyldisilazane, lithium hexamethyldisilazide, lithiumbis trimethylsilyl amide, unii-rc4n1i108m | |
| lithium;bis(trimethylsilyl)azanide |
Specifications
| 0.8910g/mL | |
| Glass bottle | |
| 114°C to 116°C | |
| 10g | |
| 95% | |
| [(CH3)3Si]2NLi | |
| 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 | |
| Solubility in water: decomposes | |
| [Li+].C[Si](C)(C)[N-][Si](C)(C)C | |
| 167.33 | |
| 167.33 | |
| 95% |
| Authentic | |
| 0.891 | |
| Yellow | |
| 4039-32-1 | |
| C6H18LiNSi2 | |
| MFCD00008261 | |
| hexamethyldisilazane lithium salt, lhmds, lihmds, lithium bis trimethylsilyl amide, lithium bis trimethylsilyl azanide, lithium bis-trimethylsilyl amide, lithium hexamethyldisilazane, lithium hexamethyldisilazide, lithiumbis trimethylsilyl amide, unii-rc4n1i108m | |
| YNESATAKKCNGOF-UHFFFAOYSA-N | |
| lithium;bis(trimethylsilyl)azanide | |
| 2733832 | |
| Crystalline Powder or Chunks | |
| Lithium bis(trimethylsilyl)amide |
Safety and Handling
GHS H Statement
Flammable solid.
Causes severe skin burns and eye damage.
Reacts violently with water.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
IF IN EYES: Rinse
GHS Signal Word: Danger
EINECSNumber : 223-725-6