missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Light Green SF, Yellowish, pure, high purity biological stain, ACROS Organics™
$88.23 - $408.40
Chemical Identifiers
| CAS | 5141-20-8 |
|---|---|
| Molecular Formula | C37H34N2Na2O9S3 |
| Molecular Weight (g/mol) | 792.844 |
| MDL Number | MFCD00012121 |
| InChI Key | DGOBMKYRQHEFGQ-UHFFFAOYSA-L |
| Synonym | Acid Green 5, C.I. 42095 |
| PubChem CID | 21223 |
| ChEBI | CHEBI:87065 |
| IUPAC Name | disodium;3-[[N-ethyl-4-[[4-[ethyl-[(3-sulfonatophenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-(4-sulfonatophenyl)methyl]anilino]methyl]benzenesulfonate |
| SMILES | CCN(CC1=CC(=CC=C1)S(=O)(=O)[O-])C2=CC=C(C=C2)C(=C3C=CC(=[N+](CC)CC4=CC(=CC=C4)S(=O)(=O)[O-])C=C3)C5=CC=C(C=C5)S(=O)(=O)[O-].[Na+].[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC229770100
|
Fisher Scientific Acros
229770100 |
10g | Glass bottle |
Each for $88.23
|
|
AC229771000
|
Thermo Fisher Scientific
AC229771000 |
100g | Glass bottle |
Each for $408.40
|
|
Chemical Identifiers
| 5141-20-8 | |
| 792.844 | |
| DGOBMKYRQHEFGQ-UHFFFAOYSA-L | |
| 21223 | |
| disodium;3-[[N-ethyl-4-[[4-[ethyl-[(3-sulfonatophenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-(4-sulfonatophenyl)methyl]anilino]methyl]benzenesulfonate |
| C37H34N2Na2O9S3 | |
| MFCD00012121 | |
| Acid Green 5, C.I. 42095 | |
| CHEBI:87065 | |
| CCN(CC1=CC(=CC=C1)S(=O)(=O)[O-])C2=CC=C(C=C2)C(=C3C=CC(=[N+](CC)CC4=CC(=CC=C4)S(=O)(=O)[O-])C=C3)C5=CC=C(C=C5)S(=O)(=O)[O-].[Na+].[Na+] |
Specifications
| 5141-20-8 | |
| C37H34N2Na2O9S3 | |
| 14, 856 | |
| Acid Green 5, C.I. 42095 | |
| Authentic | |
| disodium;3-[[N-ethyl-4-[[4-[ethyl-[(3-sulfonatophenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-(4-sulfonatophenyl)methyl]anilino]methyl]benzenesulfonate | |
| 629 to 634nm (H2O, 5mg/L, 1cm) | |
| CHEBI:87065 | |
| 792.84 | |
| ≥60% (TiCl3-titr.) (on substance as is) | |
| Glass bottle | |
| Complies | |
| Purple | |
| Light Green SF, Yellowish, Pure |
| 0.96 to 1.16 | |
| MFCD00012121 | |
| 15, 5538 | |
| DGOBMKYRQHEFGQ-UHFFFAOYSA-L | |
| CCN(CC1=CC(=CC=C1)S(=O)(=O)[O-])C2=CC=C(C=C2)C(=C3C=CC(=[N+](CC)CC4=CC(=CC=C4)S(=O)(=O)[O-])C=C3)C5=CC=C(C=C5)S(=O)(=O)[O-].[Na+].[Na+] | |
| 792.844 | |
| 21223 | |
| 10% max. (1 g, 110°C, 2 hrs) | |
| Powder, Crystals or Crystalline Powder | |
| Pure | |
| Solubility in water: 200g/L water (20°C). Other solubilities: soluble in alcohol | |
| 288.0°C | |
| 10g |