missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
![L-Tyrosine [Free Base], MP Biomedicals](https://assets.fishersci.com/TFS-Assets/CCG/product-images/mpbiomedical.jpg-650.jpg)
![L-Tyrosine [Free Base], MP Biomedicals](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-60-18-4.jpg-650.jpg)
L-Tyrosine [Free Base], MP Biomedicals
Manufacturer: Mp Biomedicals 0219475990
Specifications
| L-Tyrosine [Free Base] | |
| C9H11NO3 | |
| OUYCCCASQSFEME-QMMMGPOBSA-N | |
| (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid | |
| 6057 | |
| 181.2 | |
| Cell Culture Reagent |
| 60-18-4 | |
| 2s-2-amino-3-4-hydroxyphenyl propanoic acid, 4-hydroxy-l-phenylalanine, h-tyr-oh, l---tyrosine, l-p-tyrosine, l-tyrosine, p-tyrosine, s-tyrosine, tyrosine, tyrosine, l | |
| C1=CC(=CC=C1CC(C(=O)O)N)O | |
| 181.191 | |
| CHEBI:17895 | |
| Crystalline | |
| 500g |
Chemical Identifiers
| 60-18-4 | |
| 181.191 | |
| 2s-2-amino-3-4-hydroxyphenyl propanoic acid, 4-hydroxy-l-phenylalanine, h-tyr-oh, l---tyrosine, l-p-tyrosine, l-tyrosine, p-tyrosine, s-tyrosine, tyrosine, tyrosine, l | |
| CHEBI:17895 | |
| C1=CC(=CC=C1CC(C(=O)O)N)O |
| C9H11NO3 | |
| OUYCCCASQSFEME-QMMMGPOBSA-N | |
| 6057 | |
| (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid |
Safety and Handling
Recommended Storage : Room temperature