missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thermo Scientific™ L-Aspartyl-L-phenylalanine methyl ester, 98%
Manufacturer: Thermo Scientific™ AC228650050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| L-Aspartyl-L-phenylalanine methyl ester | |
| White | |
| 4.5% max. (105°C, 4 hrs) | |
| Authentic | |
| HO2CCH2CH(NH2)CONHCH(CH2C6H5)CO2CH3 | |
| Glass bottle | |
| asp-phe methyl ester, asp-phe-ome, aspartam, aspartame, aspartamo, aspartamum, aspartylphenylalanine methyl ester, dipeptide sweetener, l-aspartyl-l-phenylalanine methyl ester, nutrasweet | |
| Solubility in water: sparingly soluble. | |
| COC(=O)C(CC1=CC=CC=C1)NC(=O)C(N)CC(O)=O | |
| (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid | |
| 294.31 | |
| CHEBI:2877 | |
| Crystalline Powder | |
| 98% |
| 22839-47-0 | |
| 248.0°C to 250.0°C | |
| 98% | |
| C14H18N2O5 | |
| MFCD00002724 | |
| 15, 829 | |
| 5g | |
| IAOZJIPTCAWIRG-UHFFFAOYNA-N | |
| + 12.50 (20.00°C c=4,15N formic acid) | |
| + 12.50 | |
| 134601 | |
| 294.3 | |
| 0.2% max. | |
| 95% min. (c=1, 2N HCl, 430nm) 1cm cell |
Chemical Identifiers
| 22839-47-0 | |
| 294.31 | |
| IAOZJIPTCAWIRG-UHFFFAOYNA-N | |
| 134601 | |
| (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| C14H18N2O5 | |
| MFCD00002724 | |
| asp-phe methyl ester, asp-phe-ome, aspartam, aspartame, aspartamo, aspartamum, aspartylphenylalanine methyl ester, dipeptide sweetener, l-aspartyl-l-phenylalanine methyl ester, nutrasweet | |
| CHEBI:2877 | |
| COC(=O)C(CC1=CC=CC=C1)NC(=O)C(N)CC(O)=O |
Safety and Handling
EINECSNumber : 245-261-3
RUO – Research Use Only