missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
L-Aspartyl-L-phenylalanine methyl ester, 98%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC228650050
Specifications
| L-Aspartyl-L-phenylalanine methyl ester | |
| 4.5% max. (105°C, 4 hrs) | |
| + 12.50 (20.00°C c=4,15N formic acid) | |
| 0.2% max. | |
| White | |
| 5g | |
| 98% | |
| HO2CCH2CH(NH2)CONHCH(CH2C6H5)CO2CH3 | |
| 15, 829 | |
| Solubility in water: sparingly soluble. | |
| COC(=O)C(CC1=CC=CC=C1)NC(=O)C(CC(=O)O)N | |
| 294.3 | |
| CHEBI:2877 | |
| Crystalline Powder |
| Authentic | |
| Glass bottle | |
| + 12.50 | |
| 95% min. (c=1, 2N HCl, 430nm) 1cm cell | |
| 248.0°C to 250.0°C | |
| 22839-47-0 | |
| C14H18N2O5 | |
| MFCD00002724 | |
| asp-phe methyl ester, asp-phe-ome, aspartam, aspartame, aspartamo, aspartamum, aspartylphenylalanine methyl ester, dipeptide sweetener, l-aspartyl-l-phenylalanine methyl ester, nutrasweet | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid | |
| 134601 | |
| 294.3 | |
| 98% |
Chemical Identifiers
| 22839-47-0 | |
| 294.3 | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| 134601 | |
| (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| C14H18N2O5 | |
| MFCD00002724 | |
| asp-phe methyl ester, asp-phe-ome, aspartam, aspartame, aspartamo, aspartamum, aspartylphenylalanine methyl ester, dipeptide sweetener, l-aspartyl-l-phenylalanine methyl ester, nutrasweet | |
| CHEBI:2877 | |
| COC(=O)C(CC1=CC=CC=C1)NC(=O)C(CC(=O)O)N |
Safety and Handling
EINECSNumber : 245-261-3