missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
L-Aspartyl-L-phenylalanine methyl ester, 98%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC228650050
Specifications
L-Aspartyl-L-phenylalanine methyl ester | |
4.5% max. (105°C, 4 hrs) | |
+ 12.50 (20.00°C c=4,15N formic acid) | |
0.2% max. | |
White | |
5g | |
98% | |
HO2CCH2CH(NH2)CONHCH(CH2C6H5)CO2CH3 | |
15, 829 | |
Solubility in water: sparingly soluble. | |
COC(=O)C(CC1=CC=CC=C1)NC(=O)C(CC(=O)O)N | |
294.3 | |
CHEBI:2877 | |
Crystalline Powder |
Authentic | |
Glass bottle | |
+ 12.50 | |
95% min. (c=1, 2N HCl, 430nm) 1cm cell | |
248.0°C to 250.0°C | |
22839-47-0 | |
C14H18N2O5 | |
MFCD00002724 | |
asp-phe methyl ester, asp-phe-ome, aspartam, aspartame, aspartamo, aspartamum, aspartylphenylalanine methyl ester, dipeptide sweetener, l-aspartyl-l-phenylalanine methyl ester, nutrasweet | |
IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
(3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid | |
134601 | |
294.3 | |
98% |
Chemical Identifiers
22839-47-0 | |
294.3 | |
IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
134601 | |
(3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
C14H18N2O5 | |
MFCD00002724 | |
asp-phe methyl ester, asp-phe-ome, aspartam, aspartame, aspartamo, aspartamum, aspartylphenylalanine methyl ester, dipeptide sweetener, l-aspartyl-l-phenylalanine methyl ester, nutrasweet | |
CHEBI:2877 | |
COC(=O)C(CC1=CC=CC=C1)NC(=O)C(CC(=O)O)N |
Safety and Handling
EINECSNumber : 245-261-3