missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thermo Scientific™ L-Ascorbic acid sodium salt, 99%
$44.42 - $690.29
Chemical Identifiers
| CAS | 134-03-2 |
|---|---|
| Molecular Formula | C6H7NaO6 |
| Molecular Weight (g/mol) | 198.11 |
| MDL Number | MFCD00082340 |
| InChI Key | WHPNKQBYKGWBQD-PQYRJTSOSA-N |
| Synonym | aminofenitrooxon, ascorbicin, cebitate, l-ascorbic acid sodium salt, monosodium l-ascorbate, natrii ascorbas, sodascorbate, sodium ascorbate, sodium l-ascorbate, vitamin c sodium |
| PubChem CID | 131674100 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;molecular hydrogen;sodium |
| SMILES | [HH].C(C(C1C(=C(C(=O)O1)O)O)O)O.[Na] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC352680050
|
Thermo Scientific™
352680050 |
5g | Glass bottle |
Each for $44.42
|
|
AC352681000
|
Thermo Scientific™
352681000 |
100g | Plastic bottle |
Each for $97.14
|
|
AC352685000
|
Thermo Scientific™
352685000 |
500g | Plastic bottle |
Each for $188.85
|
|
AC352680025
|
Thermo Scientific™
352680025 |
2.5kg | Plastic bottle |
Each for $690.29
|
|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 134-03-2 | |
| 198.11 | |
| WHPNKQBYKGWBQD-PQYRJTSOSA-N | |
| 131674100 | |
| [HH].C(C(C1C(=C(C(=O)O1)O)O)O)O.[Na] |
| C6H7NaO6 | |
| MFCD00082340 | |
| aminofenitrooxon, ascorbicin, cebitate, l-ascorbic acid sodium salt, monosodium l-ascorbate, natrii ascorbas, sodascorbate, sodium ascorbate, sodium l-ascorbate, vitamin c sodium | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;molecular hydrogen;sodium |
Specifications
| 134-03-2 | |
| 219.0°C to 221.0°C | |
| C6H7NaO6 | |
| MFCD00082340 | |
| 15,819 | |
| aminofenitrooxon, ascorbicin, cebitate, l-ascorbic acid sodium salt, monosodium l-ascorbate, natrii ascorbas, sodascorbate, sodium ascorbate, sodium l-ascorbate, vitamin c sodium | |
| WHPNKQBYKGWBQD-PQYRJTSOSA-N | |
| + 104.00 | |
| 198.11 | |
| 198.11 | |
| 99% |
| White to Yellow | |
| 98.5 to 101.5% (Iodimetry) | |
| Authentic | |
| Glass bottle | |
| 5g | |
| (5% in water) Clear colorless to light yellow | |
| [HH].C(C(C1C(=C(C(=O)O1)O)O)O)O.[Na] | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;molecular hydrogen;sodium | |
| 131674100 | |
| Crystalline Powder | |
| L-Ascorbic acid sodium salt, 99% |
Safety and Handling
EINECSNumber : 205-126-1
RTECSNumber : CI7671000
TSCA : TSCA
RUO – Research Use Only