missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Isopropyl-β-D-Thiogalactopyranoside, >99%, MP Biomedicals
Molecular Biology Reagent. Cell culture media component for use in molecular genetics.β-Galactoside inducer
Manufacturer: MP Biochemicals LLC 19402991
Specifications
| Isopropyl-β-D-Thiogalactopyranoside | |
| 367-93-1 | |
| C9H18O5S | |
| BPHPUYQFMNQIOC-NXRLNHOXSA-N | |
| (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-propan-2-ylsulfanyloxane-3,4,5-triol | |
| 656894 | |
| 238.3 |
| 1g | |
| >99% | |
| 2r,3r,4s,5r,6s-2-hydroxymethyl-6-isopropylthio tetrahydro-2h-pyran-3,4,5-triol | |
| CC(C)SC1C(C(C(C(O1)CO)O)O)O | |
| 238.298 | |
| CHEBI:61448 |
Chemical Identifiers
| 367-93-1 | |
| 238.298 | |
| 2r,3r,4s,5r,6s-2-hydroxymethyl-6-isopropylthio tetrahydro-2h-pyran-3,4,5-triol | |
| CHEBI:61448 | |
| CC(C)SC1C(C(C(C(O1)CO)O)O)O |
| C9H18O5S | |
| BPHPUYQFMNQIOC-NXRLNHOXSA-N | |
| 656894 | |
| (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-propan-2-ylsulfanyloxane-3,4,5-triol |
Safety and Handling
Recommended Storage : 0°C