missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Isophthaloyl dichloride, 98%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 122661000
Specifications
| Isophthaloyl dichloride | |
| Authentic | |
| 276.0°C | |
| 43.0°C to 45.0°C | |
| 99-63-8 | |
| C8H4Cl2O2 | |
| 09,IV,3295 | |
| Solubility in water: reacts. Other solubilities: reacts with alcohol,soluble in ether and other organic solvents | |
| C1=CC(=CC(=C1)C(=O)Cl)C(=O)Cl | |
| 203.02 | |
| 203.02 | |
| 98% |
| 180°C | |
| Glass bottle | |
| White | |
| 100g | |
| 98% | |
| C6H4(COCl)2 | |
| 1,3-benzenedicarbonyl chloride, 1,3-benzenedicarbonyl dichloride, isophthalic acid chloride, isophthalic acid dichloride, isophthalic chloride, isophthaloyl chloride, isophthaloyl dichloride, isophthalyl chloride, isothaloyl chloride, m-phthaloyl chloride | |
| FDQSRULYDNDXQB-UHFFFAOYSA-N | |
| benzene-1,3-dicarbonyl chloride | |
| 7451 | |
| Crystalline Mass |
Chemical Identifiers
| 99-63-8 | |
| 203.02 | |
| 1,3-benzenedicarbonyl chloride, 1,3-benzenedicarbonyl dichloride, isophthalic acid chloride, isophthalic acid dichloride, isophthalic chloride, isophthaloyl chloride, isophthaloyl dichloride, isophthalyl chloride, isothaloyl chloride, m-phthaloyl chloride | |
| benzene-1,3-dicarbonyl chloride |
| C8H4Cl2O2 | |
| FDQSRULYDNDXQB-UHFFFAOYSA-N | |
| 7451 | |
| C1=CC(=CC(=C1)C(=O)Cl)C(=O)Cl |
Safety and Handling
GHS H Statement
Harmful in contact with skin.
Toxic if inhaled.
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Do not breathe dust/fume/gas/mist/vapors/spray.
IF IN EYES: Rinse cautiously with water
GHS Signal Word: Danger
EINECSNumber : 202-774-7